Name |
Isocryptomerin |
Formula |
C31H20O10 |
Mw |
552.10564686 |
CAS RN |
20931-58-2 |
C_ID |
C00006535
,
|
InChIKey |
PTKBMDRXKOIHCA-UHFFFAOYSA-N |
InChICode |
InChI=1S/C31H20O10/c1-38-27-14-26-29(22(36)13-24(41-26)15-2-6-17(32)7-3-15)30(37)31(27)39-19-8-4-16(5-9-19)23-12-21(35)28-20(34)10-18(33)11-25(28)40-23/h2-14,32-34,37H,1H3 |
SMILES |
c1cc(ccc1c1oc2c(c(=O)c1)c(cc(c2)O)O)Oc1c(cc2oc(cc(=O)c2c1O)c1ccc(cc1)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cupressaceae | Chamaecyparis obtusa | Ref. |
Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
Plantae | Cupressaceae | Cupressus cashmeriana | Ref. |
Plantae | Cupressaceae | Cupressus funebris | Ref. |
Plantae | Cupressaceae | Cupressus sempervirens | Ref. |
Plantae | Cupressaceae | Fitzroya patagonica | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Fagaceae | Quercus infectoria | Ref. |
Plantae | Taxodiaceae | Glyptostrobus lineatus | Ref. |
Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
Plantae | Taxodiaceae | Taiwania spp. | Ref. |
Plantae | Taxodiaceae | Taxodium distichum | Ref. |
Plantae | Taxodiaceae | Taxodium mucronatum | Ref. |
- | - | Selaginella tamariscina | Ref. |
|
|
zoom in
Organism | Cupressus funebris | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Miura,Tetrahedron Lett.,(1968),2339 |
---|
|