| Name |
Diplacone |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
73676-38-7 |
| C_ID |
C00008326
, 
|
| InChIKey |
XCYSQFHYFNWYFP-VIZOYTHANA-N |
| InChICode |
InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-9-17-19(27)12-23-24(25(17)30)21(29)13-22(31-23)16-8-10-18(26)20(28)11-16/h5,7-8,10-12,22,26-28,30H,4,6,9,13H2,1-3H3/b15-7+/t22-/m0/s1 |
| SMILES |
c1(c(c(c2c(c1)O[C@@H](CC2=O)c1ccc(c(c1)O)O)O)C/C=C(/CCC=C(C)C)\C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Macaranga alnifolia | Ref. |
| Plantae | Hernandiaceae | Hernandia nymphaeifolia  | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Phrymaceae | Diplacus aurantiacus | Ref. |
|
|
zoom in
| Organism | Diplacus aurantiacus |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 439,Flavanones and dihydroflavonols
Lincoln,Biochem.Syst.Ecol.,8,(1980),397 |
|---|
|
