| Name |
Inosine |
| Formula |
C10H12N4O5 |
| Mw |
268.08076952 |
| CAS RN |
58-63-9 |
| C_ID |
C00019692
, 
|
| InChIKey |
UGQMRVRMYYASKQ-CNAPFFGINA-N |
| InChICode |
InChI=1S/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7+,10+/m1/s1 |
| SMILES |
c12n(cnc1c(ncn2)O)[C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Clavicipitaceae | Cordyceps militaris cv.  | Ref. |
| Fungi | Clavicipitaceae | Cordyceps sinensis | Ref. |
| Plantae | Alliaceae | Allium tuberosum Rottl.ex Spreng. | Ref. |
| Plantae | Chenopodiaceae | Beta vulgaris | Ref. |
| Plantae | Liliaceae | Fritillaria cirrhosa | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Cordyceps sinensis |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008).
Liu, et al., Chinese J of Pharm Analysis, 30, (2010), 24 |
|---|
|
