| Name |
Protostemonine |
| Formula |
C23H31NO6 |
| Mw |
417.21513773 |
| CAS RN |
27495-40-5 |
| C_ID |
C00028860
, 
|
| InChIKey |
JDGNFRYDHRYXNL-HNNKKDKXNA-N |
| InChICode |
InChI=1S/C23H31NO6/c1-11-10-17(29-22(11)25)14-7-8-15-18-12(2)20(28-16(18)6-5-9-24(14)15)21-19(27-4)13(3)23(26)30-21/h11-12,14-18H,5-10H2,1-4H3/b21-20-/t11-,12-,14-,15-,16+,17-,18+/m0/s1 |
| SMILES |
[C@@H]12N(CCC[C@@H]3[C@@H]1[C@@H](/C(=C\1/OC(=O)C(=C1OC)C)/O3)C)[C@@H](CC2)[C@H]1OC(=O)[C@H](C1)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Stemonaceae | Stemona cf. pierrei | Ref. |
| Plantae | Stemonaceae | Stemona cochinchinensis | Ref. |
| Plantae | Stemonaceae | Stemona japonica  | Ref. |
| Plantae | Stemonaceae | Stemona kerrii | Ref. |
| Plantae | Stemonaceae | Stemona mairei | Ref. |
| Plantae | Stemonaceae | Stemona parviflora | Ref. |
| Plantae | Stemonaceae | Stemona sessilifolia | Ref. |
|
|
zoom in
| Organism | Stemona kerrii |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Kaltenegger, et al., Phytochemistry, 63, (2003), 803.
Kostecki, et al., Phytochemistry, 65, (2004), 99.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985) |
|---|
|
