Name |
alpha-Selinene (-)-alpha-Selinene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
473-13-2 |
C_ID |
C00029672
,
|
InChIKey |
OZQAPQSEYFAMCY-QRSVUVFUNA-N |
InChICode |
InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14+,15-/m1/s1 |
SMILES |
C1C=C([C@H]2[C@](C1)(CC[C@H](C2)C(=C)C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Annonaceae | Xylopia frutescens | Ref. |
Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti | Ref. |
Plantae | Asteraceae | Chamomilla recutina | Ref. |
Plantae | Burseraceae | Commiphora holtziana | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cyperaceae | Cyperus rotundus | Ref. |
Plantae | Fabaceae | Copaifera duckei | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Jubulaceae | Frullania aterrima var. aterrima | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Ranunculaceae | Nigella damascena L. | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
Plantae | Valerianaceae | Nardostachys chinensis | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb. | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Chiloscyphus polyanthos | Ref. |
- | - | Chiloscyphus polyanthus | Ref. |
|
|
zoom in
Organism | Panax ginseng | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
---|
|