| Name |
Valencene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
4630-07-3 |
| C_ID |
C00034741
, 
|
| InChIKey |
QEBNYNLSCGVZOH-ZECJTJDJNA-N |
| InChICode |
InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
| SMILES |
C1CC=C2[C@]([C@@H]1C)(C[C@@H](CC2)C(=C)C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Jubulaceae | Frullania pycnantha | Ref. |
| Plantae | Labiatae | Pogostemon cablin | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Satureja subspicata | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Porellaceae | Porella acutifolia ssp.tosana | Ref. |
| Plantae | Rutaceae | Citrus sinensis L. | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi | Ref. |
|
|
zoom in
| Organism | Pogostemon cablin |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Hashimoto, et al., Phytochemistry, 53, (2000), 593 |
|---|
|
