| Name |
Propionic acid |
| Formula |
C3H6O2 |
| Mw |
74.03677944 |
| CAS RN |
79-09-4 |
| C_ID |
C00044287
, 
|
| InChIKey |
XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
| SMILES |
OC(=O)CC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Caricaceae | Carica papaya | Ref. |
| Plantae | Convolvulaceae | Cuscuta chinensis | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Ginkgo biloba |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
