Name |
Coniferaldehyde Coniferyl aldehyde 4-Hydroxy-3-methoxycinnamaldehyde 4-hydroxy-3-methoxycinnamaldehyde |
Formula |
C10H10O3 |
Mw |
178.06299419 |
CAS RN |
458-36-6 |
C_ID |
C00002728
,
|
InChIKey |
DKZBBWMURDFHNE-NSCUHMNNSA-N |
InChICode |
InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+ |
SMILES |
c1(c(ccc(c1)/C=C/C=O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Bacteria | Pseudomonadaceae | Pseudomonas putida | Ref. |
Plantae | Aquifoliaceae | Ilex paraguariensis | Ref. |
Plantae | Asteraceae | Petasites tricholobus | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Celastraceae | Microtropis japonica | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Gliricidia sepium | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Senna incana | Ref. |
Plantae | Fagaceae | Quercus spp. | Ref. |
Plantae | Gesneriaceae | Aeschynanthus bracteatus | Ref. |
Plantae | Juglandaceae | Juglans cinerea | Ref. |
Plantae | Labiatae | Ocimum sanctum | Ref. |
Plantae | Lauraceae | Cinnamomum cassia | Ref. |
Plantae | Linaceae | Linum usitatissimum | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Moraceae | Brosimum acutifolium | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Pinaceae | Pinus radiata | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Poaceae | Phyllostachys edulis | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Rubiaceae | Morinda citrifolia L | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Salicaceae | Populus trichocarpa | Ref. |
Plantae | Sapindaceae | Acer saccharinum | Ref. |
Plantae | Sapindaceae | Acer saccharum | Ref. |
Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
Plantae | Taxaceae | Taxus mairei | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Taxodiaceae | Sequoia spp. | Ref. |
Plantae | Thymelaeaceae | Daphne feddei | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
Organism | Taxus yunnanensis | Reference | Banskota, et al., Planta Med, 69, (2003), 500.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998). |
---|
|