| Name |
Prunasin
(-)-Prunasin
(2R)-Prunasin
(-)-(2R)-Prunasin |
| Formula |
C14H17NO6 |
| Mw |
295.10558728 |
| CAS RN |
99-18-3 |
| C_ID |
C00001454
, 
|
| InChIKey |
ZKSZEJFBGODIJW-CAWHSJFGNA-N |
| InChICode |
InChI=1S/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2/t9-,10+,11+,12-,13-,14-/m0/s1 |
| SMILES |
[C@@H](C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Asteraceae | Chaptalia nutans | Ref. |
| Plantae | Asteraceae | Gerbera jamesonii var.hybrida. | Ref. |
| Plantae | Cystopteridaceae/Dryopteridaceae/Woodsiaceae | Cystopteris spp. | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
| Plantae | Fabaceae | Acacia deanei | Ref. |
| Plantae | Fabaceae | Dalbergia miscolobium | Ref. |
| Plantae | Fabaceae | Dalbergia spinosa | Ref. |
| Plantae | Fabaceae | Derris hainesiana | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Holocalyx balansae | Ref. |
| Plantae | Fabaceae | Lotononis alpina | Ref. |
| Plantae | Fabaceae | Pterocarpus soyauxii | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus | Ref. |
| Plantae | Labiatae | Clerodendrum grayi | Ref. |
| Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta. | Ref. |
| Plantae | Myrtaceae | Eucalyptus burdettiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus caleyi | Ref. |
| Plantae | Myrtaceae | Eucalyptus cylindriflora | Ref. |
| Plantae | Myrtaceae | Eucalyptus leptophleba | Ref. |
| Plantae | Myrtaceae | Eucalyptus leucoxylon | Ref. |
| Plantae | Myrtaceae | Eucalyptus megacornuta | Ref. |
| Plantae | Myrtaceae | Eucalyptus orgadophila | Ref. |
| Plantae | Myrtaceae | Eucalyptus ovata | Ref. |
| Plantae | Myrtaceae | Eucalyptus patellaris | Ref. |
| Plantae | Myrtaceae | Eucalyptus steedmanii | Ref. |
| Plantae | Myrtaceae | Eucalyptus yarraensis | Ref. |
| Plantae | Passifloraceae | Passiflora edulis | Ref. |
| Plantae | Passifloraceae | Passiflora edulis Sims | Ref. |
| Plantae | Passifloraceae | Passiflora spp. | Ref. |
| Plantae | Rosaceae | Amelanchier alnifolia | Ref. |
| Plantae | Rosaceae | Chaenomeles japonica | Ref. |
| Plantae | Rosaceae | Prunus armeniaca | Ref. |
| Plantae | Rosaceae | Prunus avium | Ref. |
| Plantae | Rosaceae | Prunus domestica | Ref. |
| Plantae | Rosaceae | Prunus dulcis | Ref. |
| Plantae | Rosaceae | Prunus laurocerasus | Ref. |
| Plantae | Rosaceae | Prunus padus | Ref. |
| Plantae | Rosaceae | Prunus persica | Ref. |
| Plantae | Rosaceae | Prunus serotina | Ref. |
| Plantae | Rosaceae | Prunus spinosa | Ref. |
| Plantae | Rosaceae | Prunus spp. | Ref. |
| Plantae | Rosaceae | Prunus virginiana | Ref. |
| Plantae | Rosaceae | Sorbus commixta | Ref. |
|
|
zoom in
| Organism | Prunus armeniaca |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
D'Abrosca, et al., Phytochemistry, 58, (2001), 1073 |
|---|
|
