Name |
Afrormosin Afromosin Castanin 7-Hydroxy-6,4'-dimethoxyisoflavone |
Formula |
C17H14O5 |
Mw |
298.08412356 |
CAS RN |
550-79-8 |
C_ID |
C00002507
,
|
InChIKey |
KJGPBYUQZLUKLL-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)13-9-22-15-8-14(18)16(21-2)7-12(15)17(13)19/h3-9,18H,1-2H3 |
SMILES |
c1(c(cc2c(c1)occ(c2=O)c1ccc(cc1)OC)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Fabaceae | Afrormosia elata | Ref. |
Plantae | Fabaceae | Amphimas pterocarpoides | Ref. |
Plantae | Fabaceae | Andira inermis | Ref. |
Plantae | Fabaceae | Astragalus clusii | Ref. |
Plantae | Fabaceae | Baptisia arachnifera | Ref. |
Plantae | Fabaceae | Baptisia australis | Ref. |
Plantae | Fabaceae | Baptisia bracteata | Ref. |
Plantae | Fabaceae | Baptisia cinerea | Ref. |
Plantae | Fabaceae | Baptisia lanceolata | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia megacarpa | Ref. |
Plantae | Fabaceae | Baptisia nuttalliana | Ref. |
Plantae | Fabaceae | Baptisia perfoliata | Ref. |
Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
Plantae | Fabaceae | Baptisia tinctoria | Ref. |
Plantae | Fabaceae | Castanospermum australe | Ref. |
Plantae | Fabaceae | Centrosema haitiense | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Cladrastis kentukea | Ref. |
Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
Plantae | Fabaceae | Dalbergia frutescens | Ref. |
Plantae | Fabaceae | Dipteryx odorata | Ref. |
Plantae | Fabaceae | Gliricidia sepium | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Millettia dielsiana | Ref. |
Plantae | Fabaceae | Millettia reticulata | Ref. |
Plantae | Fabaceae | Myrocarpus fastigiatus | Ref. |
Plantae | Fabaceae | Myroxylon balsamum | Ref. |
Plantae | Fabaceae | Myroxylon peruiferum | Ref. |
Plantae | Fabaceae | Onobrychis viciifolia | Ref. |
Plantae | Fabaceae | Pericopsis elata | Ref. |
Plantae | Fabaceae | Pericopsis mooniana | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pterodon apparicioi | Ref. |
Plantae | Fabaceae | Spatholobus suberectus | Ref. |
Plantae | Fabaceae | Taverniera abyssinica | Ref. |
Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
Plantae | Fabaceae | Wisteria floribunda | Ref. |
Plantae | Fagaceae | Castanea mollissima | Ref. |
Plantae | Myrtaceae | Rhodomyrtus tomentosa | Ref. |
|
|
zoom in
Organism | Pericopsis elata | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Eade,Aust.J.Chem.,16,(1963),188
Harborne,J.Org.Chem.,28,(1963),881 |
---|
|