Name |
3-O-Caffeoylquinic acid Chlorogenic acid Chlorogenate Heriguard Caffeoylquinic acid |
Formula |
C16H18O9 |
Mw |
354.09508217 |
CAS RN |
327-97-9 |
C_ID |
C00002724
,
|
InChIKey |
CWVRJTMFETXNAD-PCEXOASVNA-N |
InChICode |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
SMILES |
O[C@]1(C[C@H]([C@H]([C@@H](C1)OC(=O)/C=C/c1ccc(c(c1)O)O)O)O)C(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Andrographis paniculata | Ref. |
Plantae | Adoxaceae | Sambucus formosana | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Falcaria vulgaris | Ref. |
Plantae | Apiaceae | Glehnia littoralis | Ref. |
Plantae | Apocynaceae | Marsdenia cundurango | Ref. |
Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium | Ref. |
Plantae | Asteraceae | Achillea millefolium | Ref. |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Arctium lappa | Ref. |
Plantae | Asteraceae | Arnica montana cv.ARBO | Ref. |
Plantae | Asteraceae | Artemisia scoparia. | Ref. |
Plantae | Asteraceae | Aster salignus | Ref. |
Plantae | Asteraceae | Centaurea gigantea | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum L. | Ref. |
Plantae | Asteraceae | Chrysanthemum morifolium | Ref. |
Plantae | Asteraceae | Cirsium setosum | Ref. |
Plantae | Asteraceae | Helianthus annuus L.cv.Peredovick | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Lactuca indica | Ref. |
Plantae | Asteraceae | Leontodon autumnalis | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Onopordum acanthium | Ref. |
Plantae | Asteraceae | Pterocaulon virgatum | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Scorzonera divaricata | Ref. |
Plantae | Asteraceae | Senecio nemorensis | Ref. |
Plantae | Asteraceae | Solidago altissima L. | Ref. |
Plantae | Asteraceae | Solidago canadensis | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Asteraceae | Taraxacum mongolicum | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Berberidaceae | Epimedium koreanum | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Blechnaceae | Blechnum orientale | Ref. |
Plantae | Boraginaceae | Cordia macleodii | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera confusa | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera fulvotomentosa | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera hypoglauca | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera implexa | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera similis | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Chenopodiaceae | Beta vulgaris | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia jasminoides | Ref. |
Plantae | Convolvulaceae | Erycibe schimidtii | Ref. |
Plantae | Convolvulaceae | Ipomoea nil | Ref. |
Plantae | Convolvulaceae | Ipomoea njil cv. Danjuro | Ref. |
Plantae | Cruciferae | Brassica oleracea var.capitata | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron insigne | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliver | Ref. |
Plantae | Fabaceae | Acacia nilotica | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Peltophorum africanum | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Trifolium alpestre | Ref. |
Plantae | Fabaceae | Trifolium medium | Ref. |
Plantae | Fabaceae | Trifolium pratense L. | Ref. |
Plantae | Hamamelidaceae | Loropetalum chinense | Ref. |
Plantae | Hypericaceae | Hypericum perforatum | Ref. |
Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
Plantae | Labiatae | Salvia albimaculata | Ref. |
Plantae | Labiatae | Salvia horminum | Ref. |
Plantae | Labiatae | Salvia officinalis L. | Ref. |
Plantae | Labiatae | Salvia triloba | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Sideritis catillaris | Ref. |
Plantae | Lardizabalaceae | Sargentodoxa cuneata | Ref. |
Plantae | Longaniaceae | Strychnos colubrina | Ref. |
Plantae | Longaniaceae | Strychnos lucida | Ref. |
Plantae | Longaniaceae | Strychnos nux-vomica | Ref. |
Plantae | Lythraceae | Lythrum salicaria | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Malvaceae | Gossypium barbadense | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Meliaceae | Toona ciliata | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Myrtaceae | Eugenia jambolana | Ref. |
Plantae | Onocleaceae/Dryopteridaceae | Matteuccia struthiopteris | Ref. |
Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
Plantae | Plantaginaceae | Plantago bellardi | Ref. |
Plantae | Plantaginaceae | Plantago cretica | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
Plantae | Polygonaceae | Fagopyrum cymosum | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polypodiaceae | Polypodium vulgare | Ref. |
Plantae | Polypodiaceae | Pyrrosia davidii | Ref. |
Plantae | Polypodiaceae | Pyrrosia drakeana | Ref. |
Plantae | Polypodiaceae | Pyrrosia gralla | Ref. |
Plantae | Polypodiaceae | Pyrrosia lingua | Ref. |
Plantae | Polypodiaceae | Pyrrosia petiolosa | Ref. |
Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis | Ref. |
Plantae | Resedaceae | Reseda muricata C.Presl. | Ref. |
Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
Plantae | Rosaceae | Crataegus cuneata | Ref. |
Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.major | Ref. |
Plantae | Rosaceae | Eriobotrya japonica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Prunus mume | Ref. |
Plantae | Rubiaceae | Adina racemosa | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Rubiaceae | Galium verum | Ref. |
Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
Plantae | Sapindaceae | Dodonaea viscosa | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
Plantae | Solanaceae | Brunfelsia grandiflora D.DON | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum acaule | Ref. |
Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
Plantae | Solanaceae | Solanum canasense | Ref. |
Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
Plantae | Solanaceae | Solanum chacoense | Ref. |
Plantae | Solanaceae | Solanum commersonii | Ref. |
Plantae | Solanaceae | Solanum fendleri | Ref. |
Plantae | Solanaceae | Solanum habrochaites | Ref. |
Plantae | Solanaceae | Solanum hougasii | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum multidissectum | Ref. |
Plantae | Solanaceae | Solanum neorickii | Ref. |
Plantae | Solanaceae | Solanum parviflorum | Ref. |
Plantae | Solanaceae | Solanum pennellii | Ref. |
Plantae | Solanaceae | Solanum phureja | Ref. |
Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
Plantae | Solanaceae | Solanum stoloniferum | Ref. |
Plantae | Solanaceae | Solanum tarijense | Ref. |
Plantae | Solanaceae | Solanum tuberosum L. | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae | Thea sinensis | Ref. |
Plantae | Urticaceae | Urtica dioica | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana prionophylla | Ref. |
Plantae | Verbenaceae | Stachytarpheta jamaicensis | Ref. |
Plantae | Zingiberaceae | Etlingera elatior | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Apiaceae | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
- | - | Platyphora ligata | Ref. |
- | - | Stachytapheta jamaicensis | Ref. |
|
|
zoom in
Organism | Taraxacum formosanum | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Chaubal, et al., Planta Med, 69, (2003), 287.
Zidorn, et al., Phytochemistry, 66, (2005), 1691.
Kirmizibekmez, et al., Planta Med, 70, (2004), 711.
Mao, et al., Zhongguo Yaowu Huaxue Zazhi, 14, (2004), 326.
Itoh, et al., Journal of Natural Products, 66, (2003), 1212.
Yoshikawa, et al., Journal of Natural Products, 65, (2002), 1151.
Hou, et al., Journal of Natural Products, 66, (2003), 625.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
Kimura, et al., Phytochemistry, 65, (2004), 423.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Song, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 359.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Ling, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 232.
Huang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 247. |
---|
|