Name |
1,8-Cineole Eucalyptol Cineol |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
470-82-6 |
C_ID |
C00000136
,
|
InChIKey |
WEEGYLXZBRQIMU-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ |
SMILES |
C1C[C@H]2CC[C@@]1(OC2(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Fungi | Nectriaceae | Fusarium culmorum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Annonaceae | Cananga odorata | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Annonaceae | Xylopia cayennensis | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Cuminum cyminum L. | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandsuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
Plantae | Asteraceae | Achillea santolinoids | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia anethoides | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia californica | Ref. |
Plantae | Asteraceae | Artemisia cana ssp.viscidula | Ref. |
Plantae | Asteraceae | Artemisia maritima var. stechmannia | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Helichrysum italicum | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
Plantae | Burseraceae | Canarium album | Ref. |
Plantae | Calycanthaceae | Calycanthus floridus | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Hesperis matronalis | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Euphorbiaceae | Croton lechleri Mull.Arg. | Ref. |
Plantae | Fabaceae | Amorpha fruticosa | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula dentata | Ref. |
Plantae | Labiatae | Lavandula stoechas | Ref. |
Plantae | Labiatae | Mentha arvensis L. | Ref. |
Plantae | Labiatae | Mentha piperita L. | Ref. |
Plantae | Labiatae | Mentha pulegium L. | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia leucophylla | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Tetradenia riparia | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Lauraceae | Cinnamomum augustifolium | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum camphorata | Ref. |
Plantae | Lauraceae | Cinnamomum fragrans | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Lindera neesiana | Ref. |
Plantae | Lauraceae | Litsea pungens | Ref. |
Plantae | Myrtaceae | Eucalyptus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus bicostata | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis | Ref. |
Plantae | Myrtaceae | Eucalyptus cinerea | Ref. |
Plantae | Myrtaceae | Eucalyptus cineria | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodara | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora | Ref. |
Plantae | Myrtaceae | Eucalyptus deglupta | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis | Ref. |
Plantae | Myrtaceae | Eucalyptus leucoxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus macathurii | Ref. |
Plantae | Myrtaceae | Eucalyptus mackliana | Ref. |
Plantae | Myrtaceae | Eucalyptus maideni | Ref. |
Plantae | Myrtaceae | Eucalyptus maidenii | Ref. |
Plantae | Myrtaceae | Eucalyptus microcorys | Ref. |
Plantae | Myrtaceae | Eucalyptus nitens | Ref. |
Plantae | Myrtaceae | Eucalyptus pellita | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
Plantae | Myrtaceae | Eucalyptus saligna | Ref. |
Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus smithii | Ref. |
Plantae | Myrtaceae | Eucalyptus tereticornis | Ref. |
Plantae | Myrtaceae | Eucalyptus torelliana | Ref. |
Plantae | Myrtaceae | Eucalyptus viminalis | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
Plantae | Rutaceae | Zanthoxylum decaryi | Ref. |
Plantae | Saururaceae | Anemopsis californica | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Verbenaceae | Lippia javanica | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Alpinia officinarum | Ref. |
Plantae | Zingiberaceae | Alpinia zerumbet | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Hedychium coronarium | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Csitus ladaniferus | Ref. |
|
|
zoom in
Organism | Amorpha fruticosa | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986). |
---|
|