Name |
Diosmetin 5,7,3'-Trihydroxy-4'-methoxyflavone 4'-Methylluteolin |
Formula |
C16H12O6 |
Mw |
300.06338812 |
CAS RN |
520-34-3 |
C_ID |
C00001036
, 
|
InChIKey |
MBNGWHIJMBWFHU-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1cc(c(cc1)OC)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaranthaceae | Froelichia floridana | Ref. |
Plantae | Apiaceae | Cnidium monnieri  | Ref. |
Plantae | Asteraceae | Arnica spp. | Ref. |
Plantae | Asteraceae | Artemisia caerulescens | Ref. |
Plantae | Asteraceae | Artemisia iwayomogi | Ref. |
Plantae | Asteraceae | Artemisia molinieri | Ref. |
Plantae | Asteraceae | Brickellia laciniata | Ref. |
Plantae | Asteraceae | Dubautia arborea | Ref. |
Plantae | Asteraceae | Eupatorium altissimum | Ref. |
Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
Plantae | Asteraceae | Tithonia calva | Ref. |
Plantae | Boraginaceae | Nonea rosea | Ref. |
Plantae | Convolvulaceae | Merremia tridentata  | Ref. |
Plantae | Crassulaceae | Aeonium glutinosum | Ref. |
Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
Plantae | Fabaceae | Acacia farnesiana  | Ref. |
Plantae | Fabaceae | Vicia hybrida | Ref. |
Plantae | Fabaceae | Vicia melanops | Ref. |
Plantae | Fabaceae | Vicia michauxii | Ref. |
Plantae | Fabaceae | Vicia noeana | Ref. |
Plantae | Fabaceae | Vicia pannonica  | Ref. |
Plantae | Fabaceae | Vicia sicula | Ref. |
Plantae | Fabaceae | Vicia truncatu | Ref. |
Plantae | Fabaceae | Vicia villosa  | Ref. |
Plantae | Labiatae | Agastache aurantiaca | Ref. |
Plantae | Labiatae | Mentha spicata  | Ref. |
Plantae | Labiatae | Salvia candidissima | Ref. |
Plantae | Labiatae | Salvia nutans | Ref. |
Plantae | Labiatae | Salvia pratensis  | Ref. |
Plantae | Labiatae | Salvia tomentosa | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Plantaginaceae | Stemodia viscosa  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Diosma spp. | Ref. |
Plantae | Thymelaeaceae | Daphne pseudomezereum | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
Plantae | Verbenaceae | Lippia citriodora  | Ref. |
- | - | Pentemon gentianoides HBK | Ref. |
|
|
zoom in
Organism | Lippia citriodora | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids,(1967),41,Academic Press
Timmermann, Phytochemi.,18,(1979),1855 |
---|
|