Name |
Astragalin Kaempferol 3-O-beta-D-glucoside Kaempferol 3-glucoside Kaempferol 3-O-beta-D-glucopyranoside |
Formula |
C21H20O11 |
Mw |
448.10056148 |
CAS RN |
480-10-4 |
C_ID |
C00005138
,
|
InChIKey |
JPUKWEQWGBDDQB-UNCWLGIWNA-N |
InChICode |
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium porrum L. | Ref. |
Plantae | Annonaceae | Annona crassiflora | Ref. |
Plantae | Annonaceae | Bocagea sp.nov. | Ref. |
Plantae | Annonaceae | Cardiopetalum calophyllum | Ref. |
Plantae | Annonaceae | Duguetia chrysocarpa | Ref. |
Plantae | Annonaceae | Guatteria rupestris | Ref. |
Plantae | Annonaceae | Guatteria villosissima | Ref. |
Plantae | Annonaceae | Rollinia dolabripetala | Ref. |
Plantae | Annonaceae | Xylopia aromatica | Ref. |
Plantae | Apiaceae | Ammi majus L. | Ref. |
Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
Plantae | Apiaceae | Carum carvi | Ref. |
Plantae | Apocynaceae | Solenostemma argel | Ref. |
Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
Plantae | Asteraceae | Arnica montana cv.ARBO | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Asteraceae | Conyza filaginoides | Ref. |
Plantae | Asteraceae | Gerbera jamesonii | Ref. |
Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
Plantae | Asteraceae | Haplopappus foliosus | Ref. |
Plantae | Asteraceae | Helichrysum graveolen | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
Plantae | Asteraceae | Solidago altissima | Ref. |
Plantae | Asteraceae | Zinnia elegans | Ref. |
Plantae | Blechnaceae | Stenochlaena palustris | Ref. |
Plantae | Boraginaceae | Alkanna orientalis | Ref. |
Plantae | Brassicaceae | Hirschfeldia incana | Ref. |
Plantae | Chloranthaceae | Ascarina lucida | Ref. |
Plantae | Convolvulaceae | Evolvulus alsinoides | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
Plantae | Crassulaceae | Sinocrassula indica | Ref. |
Plantae | Cucurbitaceae | Marah oreganus | Ref. |
Plantae | Cupressaceae | Juniperus macropoda | Ref. |
Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ericaceae | Pyrola spp. | Ref. |
Plantae | Euphorbiaceae | Euphorbia chamaesyce | Ref. |
Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
Plantae | Euphorbiaceae | Sapium haematospermum | Ref. |
Plantae | Fabaceae | Astragalus dipelta | Ref. |
Plantae | Fabaceae | Astragalus sp. | Ref. |
Plantae | Fabaceae | Astragalus spp. | Ref. |
Plantae | Fabaceae | Baptisia spp. | Ref. |
Plantae | Fabaceae | Bauhinia variegata L. | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Lotus corniculatus | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Fabaceae | Lupinus albus L. | Ref. |
Plantae | Fabaceae | Onobrychis amoena | Ref. |
Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
Plantae | Fabaceae | Onobrychis chlorassanica | Ref. |
Plantae | Fabaceae | Onobrychis echidna | Ref. |
Plantae | Fabaceae | Onobrychis ferganica | Ref. |
Plantae | Fabaceae | Onobrychis grandis | Ref. |
Plantae | Fabaceae | Onobrychis seravschanica | Ref. |
Plantae | Fabaceae | Ononis leiosperma | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Tephrosia calophylla | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Gesneriaceae | Saintpaulia ionatha | Ref. |
Plantae | Hamamelidaceae | Liquidambar formosana | Ref. |
Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
Plantae | Iridaceae | Belamcanda chinensis | Ref. |
Plantae | Iridaceae | Crocus antalyensis | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Labiatae | Leonurus persicus | Ref. |
Plantae | Labiatae | Phlomis caucasica | Ref. |
Plantae | Labiatae | Phlomis spectabilis | Ref. |
Plantae | Labiatae | Phlomis spinidens | Ref. |
Plantae | Labiatae | Salvia cavaleriei | Ref. |
Plantae | Longaniaceae | Strychnos spinosa | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Gossypium barbadense | Ref. |
Plantae | Malvaceae | Helicteres angustifolia | Ref. |
Plantae | Moraceae | Morus alba L. | Ref. |
Plantae | Moraceae | Morus insignis | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Nymphaeaceae | Nymphaea stellata | Ref. |
Plantae | Ochnaceae | Ochna beddomei | Ref. |
Plantae | Ochnaceae | Ochna obtusata | Ref. |
Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
Plantae | Oleaceae | Nyctanthes arbortristis | Ref. |
Plantae | Phyllanthaceae | Phyllanthus niruri | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Pinaceae | Larix decidua | Ref. |
Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
Plantae | Podocarpaceae | Podocarpus nivalis | Ref. |
Plantae | Ranunculaceae | Pulsatilla cernua | Ref. |
Plantae | Rosaceae | Agrimonia eupatoria | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rubiaceae | Spermacoce laevis Roxb. | Ref. |
Plantae | Rutaceae | Haplophyllum glabrinum | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
Plantae | Solanaceae | Solanum elaeagnifolium | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Thelypteridaceae | Phegopteris connectilis | Ref. |
Plantae | Thelypteridaceae | Thelypteris nipponica | Ref. |
Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zygophyllaceae | Tribulus alatus Del. | Ref. |
|
|
zoom in
Organism | Pyrola spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nakabayashi,J.Agr.Chem.Soc.Japan,26,(1952),539 |
---|
|