Name |
(+)-Marmesin Marmesin |
Formula |
C14H14O4 |
Mw |
246.08920894 |
CAS RN |
13849-08-6 |
C_ID |
C00000584
,
|
InChIKey |
FWYSBEAFFPBAQU-STGVRZAANA-N |
InChICode |
InChI=1S/C14H14O4/c1-14(2,16)12-6-9-5-8-3-4-13(15)18-10(8)7-11(9)17-12/h3-5,7,12,16H,6H2,1-2H3/t12-/m0/s1 |
SMILES |
c12c(ccc(=O)o1)cc1c(c2)O[C@@H](C1)C(C)(C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Ammi majus | Ref. |
Plantae | Apiaceae | Angelica dahurica | Ref. |
Plantae | Apiaceae | Angelica gigas | Ref. |
Plantae | Apiaceae | Angelica pachycarpa | Ref. |
Plantae | Apiaceae | Arracacia xanthorrhiza | Ref. |
Plantae | Apiaceae | Cachrys buchorica | Ref. |
Plantae | Apiaceae | Ferulago capillaris | Ref. |
Plantae | Apiaceae | Heracleum candicans WALL. | Ref. |
Plantae | Apiaceae | Heracleum rapula | Ref. |
Plantae | Apiaceae | Notopterygium incisum | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
Plantae | Apiaceae | Peucedanum terebinthaceum | Ref. |
Plantae | Apiaceae | Pleurospermum rivulorum | Ref. |
Plantae | Apiaceae | Prangos bucharica | Ref. |
Plantae | Apiaceae | Prangos latiloba | Ref. |
Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
Plantae | Moraceae | Broussonetia papyrifera | Ref. |
Plantae | Moraceae | Broussonetia papyrigera | Ref. |
Plantae | Moraceae | Ficus carica | Ref. |
Plantae | Moraceae | Ficus cunninghamii | Ref. |
Plantae | Moraceae | Ficus eriobotryoides | Ref. |
Plantae | Moraceae | Ficus sycomorus | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Zanthoxylum arnottianum | Ref. |
Plantae | Rutaceae | Zanthoxylum belizense | Ref. |
|
|
zoom in
Organism | Arracacia xanthorrhiza | Reference | Matern,Cell Culture and Somatic Cell Genetics of Plants,Academic Press.New York,vol5,(1988),p3
Matern,Planta Med,57,(1991),S15 |
---|
|