| Name |
Malonic acid |
| Formula |
C3H4O4 |
| Mw |
104.01095862 |
| CAS RN |
141-82-2 |
| C_ID |
C00001193
, 
|
| InChIKey |
OFOBLEOULBTSOW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7) |
| SMILES |
OC(=O)CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Chenopodiaceae | Beta vulgaris | Ref. |
| Plantae | Cucurbitaceae | Gynostemma pentaphyllum | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus | Ref. |
| Plantae | Poaceae | Hordeum vulgare | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Gynostemma pentaphyllum |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
