| Name |
6-Hydroxytremetone |
| Formula |
C13H14O3 |
| Mw |
218.09429431 |
| CAS RN |
6906-88-3 |
| C_ID |
C00002399
, 
|
| InChIKey |
FHJSLVLVJPGFRY-STGVRZAANA-N |
| InChICode |
InChI=1S/C13H14O3/c1-7(2)12-5-9-4-10(8(3)14)11(15)6-13(9)16-12/h4,6,12,15H,1,5H2,2-3H3/t12-/m1/s1 |
| SMILES |
c12c(cc(c(c1)O)C(=O)C)C[C@@H](O2)C(=C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Abrotanella spp. | Ref. |
| Plantae | Asteraceae | Austrobrickellia spp. | Ref. |
| Plantae | Asteraceae | Clibadium armanii | Ref. |
| Plantae | Asteraceae | Encelia ventuorum | Ref. |
| Plantae | Asteraceae | Eupatorium rugosum | Ref. |
| Plantae | Asteraceae | Eupatorium urticaefolium | Ref. |
| Plantae | Asteraceae | Flourensia heterolepis | Ref. |
| Plantae | Asteraceae | Helianthella spp. | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Hemizonia congesta | Ref. |
| Plantae | Asteraceae | Ligularia intermedia | Ref. |
| Plantae | Asteraceae | Ligularia stenocephala | Ref. |
| Plantae | Asteraceae | Senecio spp.  | Ref. |
| Plantae | Asteraceae | Tagetes spp. | Ref. |
|
|
zoom in
| Organism | Eupatorium rugosum |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
TOYODA, et al., Chem Pharm Bull, 53, (2005), 1555 |
|---|
|
