| Name |
Matricin |
| Formula |
C17H22O5 |
| Mw |
306.14672381 |
| CAS RN |
29041-35-8 |
| C_ID |
C00003321
, 
|
| InChIKey |
SYTRJRUSWMMZLV-MEULFCEONA-N |
| InChICode |
InChI=1S/C17H22O5/c1-8-7-12(21-10(3)18)13-9(2)16(19)22-15(13)14-11(8)5-6-17(14,4)20/h5-6,9,12-15,20H,7H2,1-4H3/t9-,12-,13+,14-,15-,17-/m0/s1 |
| SMILES |
C12=C(C[C@@H]([C@@H]3[C@@H]([C@H]1[C@](C=C2)(O)C)OC(=O)[C@H]3C)OC(=O)C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea collina  | Ref. |
| Plantae | Asteraceae | Achillea collina J.Becker ex Reichenb | Ref. |
| Plantae | Asteraceae | Achillea spp. | Ref. |
| Plantae | Asteraceae | Artemisia arborescens | Ref. |
| Plantae | Asteraceae | Artemisia caruthii | Ref. |
| Plantae | Asteraceae | Jurinea maxima | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla | Ref. |
|
|
zoom in
| Organism | Artemisia caruthii |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter51 |
|---|
|
