| Name |
Lonicerin
Luteolin 7-neohesperidoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
25694-72-8 |
| C_ID |
C00004283
, 
|
| InChIKey |
SHPPXMGVUDNKLV-DPFBLAHTNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-20(33)22(35)24(37)26(38-9)42-25-23(36)21(34)18(8-28)41-27(25)39-11-5-14(31)19-15(32)7-16(40-17(19)6-11)10-2-3-12(29)13(30)4-10/h2-7,9,18,20-31,33-37H,8H2,1H3/t9-,18+,20-,21+,22-,23-,24+,25+,26-,27+/m0/s1 |
| SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
| Plantae | Asteraceae | Chrysanthemum morifolium | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica | Ref. |
| Plantae | Plantaginaceae | Veronicastrum sibiricum | Ref. |
| Plantae | Poaceae | Cymbopogon citratus | Ref. |
| Plantae | Polypodiaceae | Drynaria fortunei Kunze J.SM. | Ref. |
| Plantae | Rutaceae | Citrus aurantium | Ref. |
|
|
zoom in
| Organism | Veronicastrum sibiricum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Teslov,Khim.Prir.Soedin.,(1980),334 |
|---|
|
