| Name |
Limocitrol |
| Formula |
C18H16O9 |
| Mw |
376.07943211 |
| CAS RN |
549-10-0 |
| C_ID |
C00004792
, 
|
| InChIKey |
LCKHNFJHVWUHTR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O9/c1-24-9-6-7(4-5-8(9)19)15-13(22)11(20)10-12(21)17(25-2)14(23)18(26-3)16(10)27-15/h4-6,19,21-23H,1-3H3 |
| SMILES |
c1(c(c(c2c(c1OC)oc(c(c2=O)O)c1ccc(c(c1)OC)O)O)OC)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Primulaceae | Primula officinalis | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
|
|
zoom in
| Organism | Citrus spp. |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
