| Name |
(-)-Ribalinine
(S)-(-)-Ribalinine
Ribalinine
Ribalinidine |
| Formula |
C15H17NO3 |
| Mw |
259.12084342 |
| CAS RN |
7688-58-6 |
| C_ID |
C00026351
, 
|
| InChIKey |
HUPKGVIVTBASQC-STGVRZAANA-N |
| InChICode |
InChI=1S/C15H17NO3/c1-15(2)12(17)8-10-13(18)9-6-4-5-7-11(9)16(3)14(10)19-15/h4-7,12,17H,8H2,1-3H3/t12-/m0/s1 |
| SMILES |
c1ccc2c(c1)n(c1c(c2=O)C[C@@H](C(O1)(C)C)O)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Araliopsis soyauxii | Ref. |
| Plantae | Rutaceae | Balfourodendron riedelianum | Ref. |
| Plantae | Rutaceae | Citrus macroptera  | Ref. |
| Plantae | Rutaceae | Euodia gracilis | Ref. |
| Plantae | Rutaceae | Evodia lepta | Ref. |
| Plantae | Rutaceae | Fagara mayu | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Skimmia laureola | Ref. |
| Plantae | Rutaceae | Teclea nobilis | Ref. |
| Plantae | Rutaceae | Teclea simplicifolia | Ref. |
| Plantae | Rutaceae | Zanthoxylum mayu | Ref. |
| Plantae | Rutaceae | Zanthoxylum nitidum | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| - | - | Balfourodendrom riedelianum | Ref. |
|
|
zoom in
| Organism | Evodia lepta |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
