| Name |
Xanthoplanine
(+)-Xanthoplanine |
| Formula |
C21H26NO4 |
| Mw |
356.18618333 |
| CAS RN |
6872-88-4 |
| C_ID |
C00027170
, 
|
| InChIKey |
FGUCOPALAZXICJ-GGYSOQFKNA-O |
| InChICode |
InChI=1S/C21H25NO4/c1-22(2)7-6-12-10-18(25-4)21(26-5)20-14-11-17(24-3)16(23)9-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/p+1/t15-/m0/s1 |
| SMILES |
c1(c(cc2c(c1)c1c3[C@H](C2)[N+](CCc3cc(c1OC)OC)(C)C)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Lauraceae | Litsea cubeba | Ref. |
| Plantae | Ranunculaceae | Thalictrum foliolosum | Ref. |
| Plantae | Rutaceae | Zanthoxylum planispinum | Ref. |
|
|
zoom in
| Organism | Zanthoxylum planispinum |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
