| Name |
Forsythoside B |
| Formula |
C34H44O19 |
| Mw |
756.24767923 |
| CAS RN |
81525-13-5 |
| C_ID |
C00030317
, 
|
| InChIKey |
JMBINOWGIHWPJI-SMKOKRSRNA-N |
| InChICode |
InChI=1S/C34H44O19/c1-15-24(41)25(42)26(43)32(50-15)53-29-27(44)31(47-9-8-17-3-6-19(37)21(39)11-17)51-22(12-48-33-30(45)34(46,13-35)14-49-33)28(29)52-23(40)7-4-16-2-5-18(36)20(38)10-16/h2-7,10-11,15,22,24-33,35-39,41-46H,8-9,12-14H2,1H3/b7-4+/t15-,22+,24-,25+,26+,27+,28?,29+,30-,31+,32-,33+,34+/m0/s1 |
| SMILES |
[C@@H]1([C@@H]([C@H]([C@@H](O[C@@H]1CO[C@H]1[C@@H]([C@@](CO1)(O)CO)O)OCCc1ccc(c(c1)O)O)O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@H]1O)O)O)C)OC(=O)/C=C/c1cc(c(cc1)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Barleria lupulina  | Ref. |
| Plantae | Labiatae | Callicarpa japonica Thunb.var.luxurians Rehd. | Ref. |
| Plantae | Labiatae | Marrubium velutinum | Ref. |
| Plantae | Labiatae | Marrubium vulgare | Ref. |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Labiatae | Phlomis caucasica | Ref. |
| Plantae | Labiatae | Phlomis spinidens | Ref. |
| Plantae | Oleaceae | Forsythia suspensa | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Scrophulariaceae | Verbascum wiedemannianum | Ref. |
| Plantae | Verbenaceae | Lippia alba | Ref. |
| - | - | Pithecotenium crucigerum (L.) A.H Gentry | Ref. |
|
|
zoom in
| Organism | Phlomis brunneogaleata |
|---|
| Reference | Abougazar, et al., Planta Med, 69, (2003), 814.
Martin-Nizard, et al., Planta Med, 69, (2003), 207.
Kirmizibekmez, et al., Planta Med, 70, (2004), 711.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|
