| Name |
Sabinene hydrate |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
546-79-2 |
| C_ID |
C00048529
, 
|
| InChIKey |
KXSDPILWMGFJMM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H18O/c1-7(2)10-5-4-9(3,11)8(10)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| SMILES |
[C@@]12([C@H]([C@@](CC1)(O)C)C2)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Rutaceae | Citrus grandis | Ref. |
| Plantae | Rutaceae | Citrus hystrix | Ref. |
| Plantae | Rutaceae | Citrus paradisi | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis | Ref. |
|
|
zoom in
| Organism | Citrus reticulata |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|
