| Name |
Orientin
8-beta-D-Glucopyranosyl-3',4',5,7-tetrahydroxyflavone
Luteolin 8-C-beta-D-glucopyranoside
Lutexin |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
28608-75-5 |
| C_ID |
C00001078
, 
|
| InChIKey |
PLAPMLGJVGLZOV-RJFRUACSNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-6-14-17(28)18(29)19(30)21(32-14)16-11(26)4-10(25)15-12(27)5-13(31-20(15)16)7-1-2-8(23)9(24)3-7/h1-5,14,17-19,21-26,28-30H,6H2/t14-,17+,18-,19+,21-/m0/s1 |
| SMILES |
c1(cc(c2c(c1[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)oc(cc2=O)c1cc(c(cc1)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
| Plantae | Asteraceae | Centaurea gigantea | Ref. |
| Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
| Plantae | Asteraceae | Centaurea solstitialis | Ref. |
| Plantae | Caryophyllaceae | Lychnis flos-cuculi L. | Ref. |
| Plantae | Caryophyllaceae | Silene spp. | Ref. |
| Plantae | Chloranthaceae | Ascarina lucida | Ref. |
| Plantae | Commelinaceae | Commelina communis L  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
| Plantae | Cyatheaceae | Cyathea spp. | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
| Plantae | Fabaceae | Gleditsia sinensis Lam. | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor | Ref. |
| Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
| Plantae | Fabaceae | Retama raetam | Ref. |
| Plantae | Fabaceae | Tamarindus indica | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
| Plantae | Labiatae | Isodon rubescens var. lushanensis | Ref. |
| Plantae | Labiatae | Vitex cannabifolia Sieb.et.Zucc. | Ref. |
| Plantae | Labiatae | Vitex polygama | Ref. |
| Plantae | Linaceae | Linum usitatissimum | Ref. |
| Plantae | Lythraceae | Lythrum salicaria | Ref. |
| Plantae | Malvaceae | Theobroma cacao L. | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
| Plantae | Passifloraceae | Passiflora incarnata | Ref. |
| Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
| Plantae | Petrosaviaceae/Nartheciaceae | Japonolirion osense | Ref. |
| Plantae | Poaceae | Cymbopogon citratus | Ref. |
| Plantae | Poaceae | Hordeum vulgare | Ref. |
| Plantae | Poaceae | Pennisetum americanum | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Polygonaceae | Fagopyrum esculentum | Ref. |
| Plantae | Polygonaceae | Polygonum orientale | Ref. |
| Plantae | Ranunculaceae | Trollius chinensis | Ref. |
| Plantae | Ranunculaceae | Trollius ledebouri | Ref. |
| Plantae | Ranunculaceae | Trollius macropetalus | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| - | - | Siegesbeckia orientalis | Ref. |
|
|
zoom in
| Organism | Siegesbeckia orientalis |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Liu, et al., APS, 27, (1992), 837.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
McNally, et al., JNP, 66, (2003), 1280.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
