Name |
alpha-Terpinene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
99-86-5 |
C_ID |
C00003060
, 
|
InChIKey |
YHQGMYUVUMAZJR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
SMILES |
C1CC(=CC=C1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
Plantae | Apiaceae | Cicuta virosa  | Ref. |
Plantae | Apiaceae | Coriandrum sativum  | Ref. |
Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
Plantae | Asteraceae | Conyza newii  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Fabaceae | Trifolium repens L.  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
Plantae | Labiatae | Mentha arvensis L.  | Ref. |
Plantae | Labiatae | Mentha piperita L.  | Ref. |
Plantae | Labiatae | Mosla dianthera  | Ref. |
Plantae | Labiatae | Ocimum americanum  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Ocimum gratissimum  | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum spp. | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
Plantae | Labiatae | Origanum majorana  | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Labiatae | Tetradenia riparia  | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Cinnamomum parthenoxylum | Ref. |
Plantae | Lauraceae | Litsea ceylanica | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis x urophylla  | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Pinaceae | Cedrus libani  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Plagiochilaceae | Plagiochila standleyi | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus hystrix  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Verbenaceae | Lippia javanica  | Ref. |
Plantae | Verbenaceae | Lippia multiflora  | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Elettaria cardamomum  | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Canabis sativa | Ref. |
- | - | Citrus | Ref. |
- | - | Eucalyptus | Ref. |
|
|
zoom in
Organism | Litsea ceylanica | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,1,(1992),64A |
---|
|