Name |
Lanosterol Lanosta-8,24-dien-3beta-ol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
79-63-0 |
C_ID |
C00003657
,
|
InChIKey |
CAHGCLMLTWQZNJ-STXVIIJTNA-N |
InChICode |
InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)(C1=C(CC2)[C@]2([C@](CC1)([C@H](CC2)[C@@H](CCC=C(C)C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
Fungi | Agaricaceae | Agaricus campestris | Ref. |
Fungi | Blastocladiaceae | Allomyces macrogynus | Ref. |
Fungi | Dothideomycetes | Alternaria kikuchiana | Ref. |
Fungi | Fomitopsidaceae | Fomitopsis pinicola | Ref. |
Fungi | Meripilaceae | Grifola frondosa | Ref. |
Fungi | Mucoraceae | Mucor pusillus | Ref. |
Fungi | Nectriaceae | Gibberella fujikuroi | Ref. |
Fungi | Phycomycetaceae | Phycomyces blakesleeanus | Ref. |
Fungi | Polyporaceae | Coriolus heteromorphus | Ref. |
Fungi | Polyporaceae | Coriolus pargamenus | Ref. |
Fungi | Polyporaceae | Fomes officinalis | Ref. |
Fungi | Polyporaceae | Microporus labelliformis | Ref. |
Fungi | Pucciniaceae | Uromyces phaseoli | Ref. |
Fungi | Saccharomycetaceae | Candida albicans | Ref. |
Fungi | Saccharomycetaceae | Candida utilis | Ref. |
Fungi | Saccharomycetaceae | Pichia sp. | Ref. |
Fungi | Saccharomycetaceae | Saccharomyces cerevisiae | Ref. |
Fungi | Saccharomycetaceae | Torulopsis glabrata | Ref. |
Fungi | Sordariaceae | Neurospora crassa | Ref. |
Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
Plantae | Anacardiaceae | Lannea grandis | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Chytridium | Chytridium confervae | Ref. |
Plantae | Costaceae | Costus speciosus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Dioscoreaceae | Dioscorea deltoidea | Ref. |
Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris | Ref. |
Plantae | Euphorbiaceae | Euphorbia peplus | Ref. |
Plantae | Euphorbiaceae | Euphorbia pulcherrima | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Nitrariaceae | Peganum harmala | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Solanaceae | Capsicum annuum L. | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Physalis alkekengi var.franchetii | Ref. |
Plantae | Solanaceae | Solanum indicum | Ref. |
Plantae | Solanaceae | Solanum melongena | Ref. |
- | - | Blastocladia ramosa | Ref. |
- | - | Blastocladiella emersonii | Ref. |
- | - | Catenaria anguillulae | Ref. |
- | - | Cryptoderma citrinum | Ref. |
- | - | Hymenomycetes sp. | Ref. |
- | - | Hyphochytrium catenoides | Ref. |
- | - | Rhizidiomyces apophysatus | Ref. |
- | - | Rhyzophlyctis rosea | Ref. |
- | - | Spizellomyces punctatum | Ref. |
- | - | Ustilago maydis | Ref. |
|
|
zoom in
Organism | Hymenomycetes sp. | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY, pp.631(1983) |
---|
|