Name |
Catechin (+)-Catechin D-Catechin (+)-3',4',5,7-Tetrahydroxy-2,3-trans-flavan-3-ol Dexcyanidanol Teafuran 30A D-Catechol |
Formula |
C15H14O6 |
Mw |
290.07903818 |
CAS RN |
154-23-4 |
C_ID |
C00000947
,
|
InChIKey |
PFTAWBLQPZVEMU-UYWMCZCJNA-N |
InChICode |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H]([C@H](C2)O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus | Ref. |
Plantae | Annonaceae | Mitrella kentii | Ref. |
Plantae | Apocynaceae | Apocynum venetum | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Betulaceae | Betula papyrifera | Ref. |
Plantae | Betulaceae | Carpinus cordata | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Casuarinaceae | Casuarina equisetifolia L. | Ref. |
Plantae | Celastraceae | Gymnosporia trigyna | Ref. |
Plantae | Celastraceae | Salacia prinoides | Ref. |
Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
Plantae | Cistaceae | Cistus salviifolius | Ref. |
Plantae | Combretaceae | Combretum quadrangulare | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Elaeagnaceae | Elaeagnus angustifolia | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
Plantae | Ericaceae | Rhododendron calophytum | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron galactinum | Ref. |
Plantae | Ericaceae | Rhododendron insigne | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
Plantae | Ericaceae | Rhododendron ungernii | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Erythroxylaceae | Erythroxylum cambodianum | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliver | Ref. |
Plantae | Euphorbiaceae | Croton urucurana | Ref. |
Plantae | Fabaceae | Acacia adunca | Ref. |
Plantae | Fabaceae | Acacia calamifolia | Ref. |
Plantae | Fabaceae | Acacia cardiophylla | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Fabaceae | Acacia chrysotricha | Ref. |
Plantae | Fabaceae | Acacia clunies-rossiae | Ref. |
Plantae | Fabaceae | Acacia concurrens | Ref. |
Plantae | Fabaceae | Acacia constablei | Ref. |
Plantae | Fabaceae | Acacia cultriformis | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Acacia deanei | Ref. |
Plantae | Fabaceae | Acacia decurrens | Ref. |
Plantae | Fabaceae | Acacia elata | Ref. |
Plantae | Fabaceae | Acacia erioloba | Ref. |
Plantae | Fabaceae | Acacia falciformis | Ref. |
Plantae | Fabaceae | Acacia filicifolia | Ref. |
Plantae | Fabaceae | Acacia fimbriata | Ref. |
Plantae | Fabaceae | Acacia holosericea | Ref. |
Plantae | Fabaceae | Acacia irrorata | Ref. |
Plantae | Fabaceae | Acacia ixiophylla | Ref. |
Plantae | Fabaceae | Acacia kettlewelliae | Ref. |
Plantae | Fabaceae | Acacia lanigera | Ref. |
Plantae | Fabaceae | Acacia leucoclada | Ref. |
Plantae | Fabaceae | Acacia longifolia | Ref. |
Plantae | Fabaceae | Acacia mabellae | Ref. |
Plantae | Fabaceae | Acacia mearnsii | Ref. |
Plantae | Fabaceae | Acacia melanoxylon | Ref. |
Plantae | Fabaceae | Acacia mollifolia | Ref. |
Plantae | Fabaceae | Acacia neriifolia | Ref. |
Plantae | Fabaceae | Acacia nilotica | Ref. |
Plantae | Fabaceae | Acacia obtusifolia | Ref. |
Plantae | Fabaceae | Acacia omalophylla | Ref. |
Plantae | Fabaceae | Acacia oshanesii | Ref. |
Plantae | Fabaceae | Acacia oswaldii | Ref. |
Plantae | Fabaceae | Acacia parramattensis | Ref. |
Plantae | Fabaceae | Acacia pendula | Ref. |
Plantae | Fabaceae | Acacia planifrons | Ref. |
Plantae | Fabaceae | Acacia retinodes | Ref. |
Plantae | Fabaceae | Acacia rigens | Ref. |
Plantae | Fabaceae | Acacia silvestris | Ref. |
Plantae | Fabaceae | Acacia terminalis | Ref. |
Plantae | Fabaceae | Acacia trachyphloia | Ref. |
Plantae | Fabaceae | Acacia verniciflua | Ref. |
Plantae | Fabaceae | Acacia vestita | Ref. |
Plantae | Fabaceae | Alhagi kirghisorum | Ref. |
Plantae | Fabaceae | Alhagi maurorum | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Astragalus floccosifolius | Ref. |
Plantae | Fabaceae | Astragalus kabadianus | Ref. |
Plantae | Fabaceae | Cassia fistula | Ref. |
Plantae | Fabaceae | Cassia roxburghii | Ref. |
Plantae | Fabaceae | Colophospermum mopane | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Gleditsia triacanthos | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Parkia biglobosa | Ref. |
Plantae | Fabaceae | Prosopis nigra | Ref. |
Plantae | Fabaceae | Prosopis torquata | Ref. |
Plantae | Fabaceae | Schotia brachypetala | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna angularis | Ref. |
Plantae | Fabaceae | Wisteria sinensis | Ref. |
Plantae | Fagaceae | Quercus robur | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Grossulariaceae | Ribes fasciculatum var.chinense | Ref. |
Plantae | Hamamelidaceae | Liquidambar styraciflua | Ref. |
Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
Plantae | Lauraceae | Cinnamomum sieboldii | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Machilus thunbergii | Ref. |
Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Malvaceae | Ceiba pentandra | Ref. |
Plantae | Malvaceae | Cola acuminata | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Malvaceae | Theobroma grandiflorum | Ref. |
Plantae | Meliaceae | Melia azedarach var.japonica | Ref. |
Plantae | Meliaceae | Toona sinensis | Ref. |
Plantae | Meliaceae | Xylocarpus granatum | Ref. |
Plantae | Moraceae | Artocarpus dadah | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myrsinaceae | Embelia ribes Burm. | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Palmae | Areca catechu | Ref. |
Plantae | Palmae | Chamaerops humilis | Ref. |
Plantae | Palmae | Desmoncus polyacanthos | Ref. |
Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
Plantae | Palmae | Trachycarpus fortunei | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Larix decidua Miller. | Ref. |
Plantae | Pinaceae | Larix sibirica | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Pinus sibirica L. | Ref. |
Plantae | Pinaceae | Pinus sylvestris L. | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Rheum emodi | Ref. |
Plantae | Polygonaceae | Rheum palmatum | Ref. |
Plantae | Polygonaceae | Rheum tanguticum | Ref. |
Plantae | Polygonaceae | Rumex patientia | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba | Ref. |
Plantae | Rosaceae | Agrimonia pilosa var.japonica | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Crataegus monogyna calli | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Rosaceae | Prunus tomentosa | Ref. |
Plantae | Rosaceae | Rosa amblyotis | Ref. |
Plantae | Rosaceae | Rosa cymosa | Ref. |
Plantae | Rosaceae | Rosa maximowicziana | Ref. |
Plantae | Rubiaceae | Uncaria gambir | Ref. |
Plantae | Rubiaceae | Uncaria lanosa | Ref. |
Plantae | Rutaceae | Euodia meliaefolia | Ref. |
Plantae | Salicaceae | Salix caprea | Ref. |
Plantae | Sapindaceae | Acer nikoense | Ref. |
Plantae | Sapotaceae | Manilkara zapota cv.Tikal | Ref. |
Plantae | Solanaceae | Solanum tuberosum subsp. Andigena | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Typhaceae | Typha capensis (Rohrb.) N. E. Br | Ref. |
Plantae | Ulmaceae | Ulmus pumila | Ref. |
Plantae | Vitaceae | Ampelopsis japonica | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Etlingera elatior | Ref. |
- | - | Actinida arguta | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Fugopyrum esculentum calli | Ref. |
- | - | Okoubaka aubrevillei | Ref. |
- | - | Rhei rhizoma | Ref. |
- | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
Organism | Acacia catechu | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Perkin,J.Chem.Soc.,81,(1902),1160
Hardegger,Helv.Chim.Acta,40,(1957),1819 |
---|
|