Name |
Tetradecanoic acid Myristic acid n-Tetradecanoic acid |
Formula |
C14H28O2 |
Mw |
228.20893014 |
CAS RN |
544-63-8 |
C_ID |
C00001228
, 
|
InChIKey |
TUNFSRHWOTWDNC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16) |
SMILES |
C(=O)(O)CCCCCCCCCCCCC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
Plantae | Amaranthaceae | Celosia cristada | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Angelica sinensis  | Ref. |
Plantae | Apiaceae | Conioselinum vaginatum | Ref. |
Plantae | Apiaceae | Notopterygium incisum  | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
Plantae | Asteraceae | Inula britannica var.chinensis  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Senecio vulgaris  | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta  | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Iridaceae | Iris flomentina | Ref. |
Plantae | Iridaceae | Iris florentina | Ref. |
Plantae | Jubulaceae | Frullania anomala | Ref. |
Plantae | Jubulaceae | Frullania incumbens | Ref. |
Plantae | Jubulaceae | Frullania lobulata | Ref. |
Plantae | Jubulaceae | Frullania probosciphora | Ref. |
Plantae | Jubulaceae | Frullania scandens | Ref. |
Plantae | Jubulaceae | Frullania spinifera | Ref. |
Plantae | Labiatae | Vitex trifolia  | Ref. |
Plantae | Laminariaceae | Laminaria japonica  | Ref. |
Plantae | Lauraceae | Litsea monopetala  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
Plantae | Myristicaceae | Myristica fragrans  | Ref. |
Plantae | Myristicaceae | Myristica moschata | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
Plantae | Palmae | Areca catechu  | Ref. |
Plantae | Pandanaceae | Pandanus conoideus Lam  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Plantaginaceae | Plantago major  | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
Plantae | Rosaceae | Prunus armeniaca  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Murraya paniculata  | Ref. |
Plantae | Santalaceae | Santalum album  | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
Plantae | Scrophulariaceae | Diascia cordata | Ref. |
Plantae | Scrophulariaceae | Diascia integerrima | Ref. |
Plantae | Scrophulariaceae | Diascia megathura | Ref. |
Plantae | Scrophulariaceae | Diascia purpurea | Ref. |
Plantae | Scrophulariaceae | Diascia vigilis | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
- | - | Bergera koenegii | Ref. |
- | - | FOOD SAKE | Ref. |
- | - | Hipppophae rhamnoides | Ref. |
- | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
Organism | Plantago major | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chen, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 30, (1995), 526.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Calixto, et al., Planta Med, 69, (2003), 973.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|