Name |
Salvigenin |
Formula |
C18H16O6 |
Mw |
328.09468824 |
CAS RN |
19103-54-9 |
C_ID |
C00003840
,
|
InChIKey |
QCDYOIZVELGOLZ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)18(23-3)17(16)20/h4-9,20H,1-3H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)OC)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea millefolium | Ref. |
Plantae | Asteraceae | Artemisia anomala | Ref. |
Plantae | Asteraceae | Heterotheca psammophila | Ref. |
Plantae | Asteraceae | Mikania cordata | Ref. |
Plantae | Betulaceae | Alnus japonica | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Bignoniaceae | Phyllarthron madagascariensis | Ref. |
Plantae | Fabaceae | Millettia pachycarpa | Ref. |
Plantae | Labiatae | Mentha x citrata | Ref. |
Plantae | Labiatae | Mentha x piperita | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
Plantae | Labiatae | Ocimum basilicum L. | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicum L. | Ref. |
Plantae | Labiatae | Ocimum minimum L. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Plectranthus fruticosus | Ref. |
Plantae | Labiatae | Salvia aethiopis | Ref. |
Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
Plantae | Labiatae | Salvia candidissima | Ref. |
Plantae | Labiatae | Salvia chinopeplica | Ref. |
Plantae | Labiatae | Salvia columbariae | Ref. |
Plantae | Labiatae | Salvia cyanescens | Ref. |
Plantae | Labiatae | Salvia heldrichiana | Ref. |
Plantae | Labiatae | Salvia hypoleuca | Ref. |
Plantae | Labiatae | Salvia lanigera | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia lavandulifolia | Ref. |
Plantae | Labiatae | Salvia macrosiphon | Ref. |
Plantae | Labiatae | Salvia mirzayana | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Labiatae | Salvia syriaca | Ref. |
Plantae | Labiatae | Salvia syriaca L. | Ref. |
Plantae | Labiatae | Salvia triloba | Ref. |
Plantae | Labiatae | Salvia verbenaca | Ref. |
Plantae | Labiatae | Salvia virgata | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Labiatae | Teucrium polium subsp.pilosum. | Ref. |
Plantae | Labiatae | Teucrium polium var.alba. | Ref. |
Plantae | Labiatae | Teucrium ramosissimum | Ref. |
Plantae | Pteridaceae | Notholaena rigida | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Verbenaceae | Clerodendron inerme | Ref. |
Plantae | Verbenaceae | Lantana fucata | Ref. |
Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
- | - | Clerodendranthus spicatus | Ref. |
|
|
zoom in
Organism | Clerodendranthus spicatus | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
ONO, et al., Chem Pharm Bull, 53, (2005), 1175 |
---|
|