| Name |
Chrysin
5,7-Dihydroxyflavone
5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
480-40-0 |
| C_ID |
C00003794
, 
|
| InChIKey |
RTIXKCRFFJGDFG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccccc1)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Asteraceae | Artemisia campestris ssp. glutinosa | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
| Plantae | Asteraceae | Flourensia resinosa | Ref. |
| Plantae | Asteraceae | Mikania hirsutissima | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum | Ref. |
| Plantae | Bignoniaceae | Pajanelia multijuga | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica | Ref. |
| Plantae | Chenopodiaceae | Chenopodium graveolens | Ref. |
| Plantae | Cistaceae | Cistus populifolius | Ref. |
| Plantae | Escalloniaceae | Escallonia spp. | Ref. |
| Plantae | Fabaceae | Acacia constricta | Ref. |
| Plantae | Fabaceae | Acacia neovernicosa | Ref. |
| Plantae | Fabaceae | Ononis vaginalis | Ref. |
| Plantae | Fabaceae | Oxytropis pseudoglandulosa | Ref. |
| Plantae | Fabaceae | Spartium junceum | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
| Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis | Ref. |
| Plantae | Labiatae | Scutellaria discolor | Ref. |
| Plantae | Labiatae | Scutellaria oreophila | Ref. |
| Plantae | Labiatae | Scutellaria orientalis | Ref. |
| Plantae | Labiatae | Scutellaria strigillosa | Ref. |
| Plantae | Orchidaceae | Cypripedium macranthos var. rebunense | Ref. |
| Plantae | Passifloraceae | Passiflora caerulea | Ref. |
| Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
| Plantae | Phrymaceae | Mimulus moschatus | Ref. |
| Plantae | Pinaceae | Pinus aristata | Ref. |
| Plantae | Pinaceae | Pinus excelsa | Ref. |
| Plantae | Pinaceae | Pinus monticola | Ref. |
| Plantae | Pinaceae | Pinus spp. | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Pteridaceae | Cheilanthes kaulfussii | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Prunus cerasus | Ref. |
| Plantae | Rubiaceae | Adina cordifolia Roxb. | Ref. |
| Plantae | Salicaceae | Populus alba | Ref. |
| Plantae | Salicaceae | Populus alba var.pyramdalis | Ref. |
| Plantae | Salicaceae | Populus bejingensis | Ref. |
| Plantae | Salicaceae | Populus canadensis | Ref. |
| Plantae | Salicaceae | Populus davidiana | Ref. |
| Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus tomentosa | Ref. |
| Plantae | Salicaceae | Populus xiaohei | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Ulmaceae | Ulmus sieboldiana | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica | Ref. |
|
|
zoom in
| Organism | Populus spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Scheele,J.Nat.Prod.,60,(1987)181
Tomimori,Chem.Pharm.Bull.,36,(1988),3654 |
|---|
|
