Name |
Oroxylin A |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
480-11-5 |
C_ID |
C00003804
,
|
InChIKey |
LKOJGSWUMISDOF-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-16-11(18)8-13-14(15(16)19)10(17)7-12(21-13)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccccc1)O)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
Plantae | Amaranthaceae | Gomphrena boliviana | Ref. |
Plantae | Amaranthaceae | Gomphrena martiana | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Asteraceae | Carthamus glauca | Ref. |
Plantae | Asteraceae | Flourensia laurifolia | Ref. |
Plantae | Bignoniaceae | Oroxylum indicum | Ref. |
Plantae | Bignoniaceae | Pajanelia multijuga | Ref. |
Plantae | Capparaceae | Capparis himalayensis | Ref. |
Plantae | Labiatae | Scutellaria amoena | Ref. |
Plantae | Labiatae | Scutellaria baicalensis GEORGI | Ref. |
Plantae | Labiatae | Scutellaria hypericifolia | Ref. |
Plantae | Labiatae | Scutellaria likiangensis | Ref. |
Plantae | Labiatae | Scutellaria rehderiana | Ref. |
Plantae | Labiatae | Scutellaria seleriana | Ref. |
Plantae | Labiatae | Scutellaria viscidula | Ref. |
Plantae | Rosaceae | Adenostoma sparsifolium | Ref. |
|
|
zoom in
Organism | Flourensia laurifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids, (1967) Academic Press
Buschi,Phytochem.,20,(1981),1178 |
---|
|