Name |
Ladanein |
Formula |
C17H14O6 |
Mw |
314.07903818 |
CAS RN |
10176-71-3 |
C_ID |
C00003839
,
|
InChIKey |
UUQJTIHOVGMQIH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)12-7-11(18)15-13(23-12)8-14(22-2)16(19)17(15)20/h3-8,19-20H,1-2H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)OC)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia argyi | Ref. |
Plantae | Asteraceae | Artemisia aygyi | Ref. |
Plantae | Asteraceae | Baccharis tucumanensis | Ref. |
Plantae | Asteraceae | Pulicaria paludosa | Ref. |
Plantae | Bignoniaceae | Catalpa bignonioides | Ref. |
Plantae | Labiatae | Ballota hirsuta | Ref. |
Plantae | Labiatae | Marrubium thessalum | Ref. |
Plantae | Labiatae | Marrubium trachyticum | Ref. |
Plantae | Labiatae | Mentha piperita | Ref. |
Plantae | Labiatae | Micromeria albanica | Ref. |
Plantae | Labiatae | Nepeta pungens | Ref. |
Plantae | Labiatae | Nepeta saturejoides | Ref. |
Plantae | Labiatae | Ocimum spp. | Ref. |
Plantae | Labiatae | Orthosiphon stamineus | Ref. |
Plantae | Labiatae | Salvia cyanescens | Ref. |
Plantae | Labiatae | Salvia hypoleuca | Ref. |
Plantae | Labiatae | Salvia stenophylla | Ref. |
Plantae | Labiatae | Salvia syriaca | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
|
|
zoom in
Organism | Ballota hirsuta | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Markham, Mikrochim.Acta,(1970),590
San Feliciano,Phytochem.,28,(1989),2717 |
---|
|