Name |
Gnaphaliin 5,7-Dihydroxy-3,8-dimethoxyflavone 3-O-Methyl-8-methoxygalangin 5,7-Dihydroxy-3,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
Formula |
C17H14O6 |
Mw |
314.07903818 |
CAS RN |
33803-42-8 |
C_ID |
C00004556
,
|
InChIKey |
OWQLBLNRUZULFV-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O6/c1-21-15-11(19)8-10(18)12-13(20)17(22-2)14(23-16(12)15)9-6-4-3-5-7-9/h3-8,18-19H,1-2H3 |
SMILES |
c1(cc(c2c(c1OC)oc(c(c2=O)OC)c1ccccc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achyrocline spp. | Ref. |
Plantae | Asteraceae | Anaphalis margaritacea | Ref. |
Plantae | Asteraceae | Gnaphalium luteo-album | Ref. |
Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
Plantae | Asteraceae | Gnaphalium obtusifolium | Ref. |
Plantae | Asteraceae | Gnaphalium robustum | Ref. |
Plantae | Asteraceae | Gymnosperma glutinosum | Ref. |
Plantae | Asteraceae | Helichrysum aureum | Ref. |
Plantae | Asteraceae | Helichrysum bracteiferum | Ref. |
Plantae | Asteraceae | Helichrysum italicum | Ref. |
Plantae | Asteraceae | Helichrysum picardii | Ref. |
Plantae | Asteraceae | Ozothamnus ericifolius | Ref. |
Plantae | Asteraceae | Ozothamnus purpurescens | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus alessandri | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
|
|
zoom in
Organism | Gnaphalium robustum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wagner,Chem.Ber.,104,(1971),2381
Opitz,Phytochem.,10,(1971),1948) |
---|
|