| Name |
Cupressuflavone tetramethyl ether |
| Formula |
C34H26O10 |
| Mw |
594.15259705 |
| CAS RN |
13738-92-6 |
| C_ID |
C00006464
, 
|
| InChIKey |
KQVQZFVRSOIPIV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C34H26O10/c1-39-19-9-5-17(6-10-19)25-13-21(35)29-23(37)15-27(41-3)31(33(29)43-25)32-28(42-4)16-24(38)30-22(36)14-26(44-34(30)32)18-7-11-20(40-2)12-8-18/h5-16,37-38H,1-4H3 |
| SMILES |
c1(cc(c2c(c1c1c(cc(c3c1oc(cc3=O)c1ccc(cc1)OC)O)OC)oc(cc2=O)c1ccc(cc1)OC)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Agathis australis  | Ref. |
| Plantae | Araucariaceae | Agathis ovata | Ref. |
| Plantae | Araucariaceae | Araucaria columnaris | Ref. |
| Plantae | Araucariaceae | Araucaria cunninghamii | Ref. |
| Plantae | Araucariaceae | Araucaria excelsa | Ref. |
| Plantae | Podocarpaceae | Lepidothamnus spp. | Ref. |
|
|
zoom in
| Organism | Lepidothamnus spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Rahman,Tetrahedron Lett.,(1968),675
Ilyas,Terahedron Lett.,(1968),5515 |
|---|
|
