| Name |
Delphinidin 3,7,3'-triglucoside |
| Formula |
C33H41O22 |
| Mw |
789.208948 |
| CAS RN |
64963-58-2 |
| C_ID |
C00006719
, 
|
| InChIKey |
VHSJCOIXEZIXCZ-HRNBVMSZNA-O |
| InChICode |
InChI=1S/C33H40O22/c34-6-17-21(40)24(43)27(46)31(53-17)49-10-3-12(37)11-5-16(52-33-29(48)26(45)23(42)19(8-36)55-33)30(50-14(11)4-10)9-1-13(38)20(39)15(2-9)51-32-28(47)25(44)22(41)18(7-35)54-32/h1-5,17-19,21-29,31-36,40-48H,6-8H2,(H2-,37,38,39)/p+1/t17-,18-,19+,21+,22+,23+,24-,25-,26-,27+,28-,29+,31+,32+,33+/m0/s1 |
| SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)O[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio cruentus | Ref. |
| Plantae | Bromeliaceae | Puya alpestris | Ref. |
| Plantae | Bromeliaceae | Puya coerulea | Ref. |
| Plantae | Bromeliaceae | Puya densiflora | Ref. |
| Plantae | Commelinaceae | Gibasis consobrina | Ref. |
| Plantae | Commelinaceae | Tradescantia spp. | Ref. |
|
|
zoom in
| Organism | Tradescantia spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Scogin,Biochem.Syst.Ecol.,13,(1985),387 |
|---|
|
