| Name |
Petunidin 3-O-beta-D-glucopyranoside
Petunidin 3-glucoside |
| Formula |
C22H23O12 |
| Mw |
479.1189512 |
| CAS RN |
6988-81-4 |
| C_ID |
C00006722
, 
|
| InChIKey |
CCQDWIRWKWIUKK-ARDHMINRNA-O |
| InChICode |
InChI=1S/C22H22O12/c1-31-14-3-8(2-12(26)17(14)27)21-15(6-10-11(25)4-9(24)5-13(10)32-21)33-22-20(30)19(29)18(28)16(7-23)34-22/h2-6,16,18-20,22-23,28-30H,7H2,1H3,(H3-,24,25,26,27)/p+1/t16-,18-,19+,20-,22-/m1/s1 |
| SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)OC)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus | Ref. |
| Plantae | Berberidaceae | Berberis buxifolia | Ref. |
| Plantae | Berberidaceae | Berberis fortunei | Ref. |
| Plantae | Ericaceae | Gaylussacia spp. | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus L. | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Fabaceae | Astragalus sinicus | Ref. |
| Plantae | Fabaceae | Cercis chinensis | Ref. |
| Plantae | Fabaceae | Clitoria ternatea | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Fabaceae | Lespedeza penduliflora | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Vigna subterranea | Ref. |
| Plantae | Fouquieriacea | Fouquieria spp. | Ref. |
| Plantae | Hyacinthaceae | Muscari armeniacum | Ref. |
| Plantae | Lythraceae | Lagerstroemia indica | Ref. |
| Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
| Plantae | Myrtaceae | Metrosideros spp. | Ref. |
| Plantae | Orchidaceae | Broughtonia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora suberosa | Ref. |
| Plantae | Pinaceae | Abies spp. | Ref. |
| Plantae | Pinaceae | Picea spp. | Ref. |
| Plantae | Pinaceae | Pinus banksiana | Ref. |
| Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
| Plantae | Pinaceae | Tsuga spp. | Ref. |
| Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
| Plantae | Zingiberaceae | Renealmia regmelliana | Ref. |
|
|
zoom in
| Organism | Gaylussacia spp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Pomilio,Phytochem.,12,(1973),218
Carreno-Diaz,J.Food Sci.,34,(1969),415 |
|---|
|
