Name |
24-Methylene cholesterol 24-Methylcholesta-5,24(28)-dien-3beta-ol 24-Methylenecholesterol |
Formula |
C28H46O |
Mw |
398.35486609 |
CAS RN |
474-63-5 |
C_ID |
C00007271
, 
|
InChIKey |
INDVLXYUCBVVKW-QULHGUPUNA-N |
InChICode |
InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18,20,22-26,29H,3,7-8,10-17H2,1-2,4-6H3/t20-,22+,23+,24-,25+,26-,27+,28-/m1/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@@H](CCC(=C)C(C)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Drepanidae | Achlya bisexualis | Ref. |
Chromalveolata | Pelagophyceae | Aureoumbra lagunensis | Ref. |
Chromalveolata | Saprolegniaceae | Saprolegnia ferax | Ref. |
Chromalveolata | Saprolegniaceae | Saprolegnia megasperma | Ref. |
Chromista | Pelagomonadaceae | Aureococcus anophagefferens | Ref. |
Fungi | Glomeraceae | Glomus sp. | Ref. |
Fungi | Rhizophydiaceae | Rhizophydium sphaerotheca | Ref. |
Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Laminariaceae | Laminaria japonica  | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
- | - | Leptolegnia caudata | Ref. |
- | - | Nephthea chabroli | Ref. |
- | - | Pythiopsis cymosa | Ref. |
- | - | Sinularia dura | Ref. |
- | - | Sinularia gibberosa | Ref. |
- | - | Sinularia maxima | Ref. |
|
|
zoom in
Organism | Glomus sp. | Reference | Lenfant,Phytochem.,9,(1970),2529-2535
Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Poppleston,Phytochem.,12,(1973),1131-1133
Turner,Fungal Metabolites II
Academic Press,New York, |
---|
|