| Name |
Aframodial
Miogadial
8beta,17-Epoxyl-12E-labdene-15,16-dial |
| Formula |
C20H30O3 |
| Mw |
318.21949482 |
| CAS RN |
71641-23-1 |
| C_ID |
C00022440
, 
|
| InChIKey |
ZAWCPGMKVKTLKI-BBNPPQLLNA-N |
| InChICode |
InChI=1S/C20H30O3/c1-18(2)9-4-10-19(3)16(18)7-11-20(14-23-20)17(19)6-5-15(13-22)8-12-21/h5,12-13,16-17H,4,6-11,14H2,1-3H3/b15-5+/t16-,17+,19+,20+/m0/s1 |
| SMILES |
C1CC([C@H]2[C@@](C1)([C@H]([C@]1(CC2)OC1)C/C=C(/C=O)\CC=O)C)(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Aframomum daniellii | Ref. |
| Plantae | Zingiberaceae | Aframomum daniellin | Ref. |
| Plantae | Zingiberaceae | Aframomum zambesiacum (Baker) K.Schum.  | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
| Organism | Zingiber officinale |
|---|
| Reference | Asili, et al., Journal of Natural Products, 67, (2004), 631.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Haraguchi, et al., Planta Med, 62, (1996), 308.
Morita, et al., Planta Med, 54, (1988), 117.
Tanabe, et al., Chem Pharm Bull, 41, (1993), 710. |
|---|
|
