Name |
Isocorydine (+)-Isocorydine (S)-(+)-Isocorydine L-(+)-Isocorydine |
Formula |
C20H23NO4 |
Mw |
341.16270823 |
CAS RN |
475-67-2 |
C_ID |
C00001872
, 
|
InChIKey |
QELDJEKNFOQJOY-UGPWUYPHNA-N |
InChICode |
InChI=1S/C20H23NO4/c1-21-8-7-12-10-15(24-3)20(25-4)18-16(12)13(21)9-11-5-6-14(23-2)19(22)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3/t13-/m0/s1 |
SMILES |
c1(c2c3c(cc1OC)CCN([C@H]3Cc1c2c(c(cc1)OC)O)C)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona cherimola  | Ref. |
Plantae | Annonaceae | Annona glabra  | Ref. |
Plantae | Annonaceae | Annona purpurea  | Ref. |
Plantae | Annonaceae | Annona senegalensis  | Ref. |
Plantae | Annonaceae | Artabotrys suaveolens | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
Plantae | Annonaceae | Guatteria oliviformis | Ref. |
Plantae | Annonaceae | Miliusa velutina  | Ref. |
Plantae | Berberidaceae | Berberis densiflora | Ref. |
Plantae | Berberidaceae | Berberis heterobotrys | Ref. |
Plantae | Berberidaceae | Berberis oblonga | Ref. |
Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
Plantae | Berberidaceae | Nandina domestica  | Ref. |
Plantae | Euphorbiaceae | Croton chilensis | Ref. |
Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
Plantae | Fumariaceae | Corydalis cava  | Ref. |
Plantae | Fumariaceae | Corydalis lutea | Ref. |
Plantae | Fumariaceae | Corydalis ochroleuca | Ref. |
Plantae | Fumariaceae | Corydalis solida  | Ref. |
Plantae | Fumariaceae | Corydalis tuberosa | Ref. |
Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
Plantae | Fumariaceae | Dicentra canadensis  | Ref. |
Plantae | Fumariaceae | Hypecoum procumbens | Ref. |
Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
Plantae | Lauraceae | Dehaasia incrassata | Ref. |
Plantae | Lauraceae | Dehaasia triandra | Ref. |
Plantae | Lauraceae | Lindera pipericarpa | Ref. |
Plantae | Lauraceae | Litsea cubeba  | Ref. |
Plantae | Lauraceae | Litsea deccanensis | Ref. |
Plantae | Lauraceae | Ocotea benesii | Ref. |
Plantae | Lauraceae | Ocotea holdrigeana | Ref. |
Plantae | Lauraceae | Ocotea holdrigeiana | Ref. |
Plantae | Lauraceae | Ocotea vellosiana | Ref. |
Plantae | Lauraceae | Phoebe clemensii | Ref. |
Plantae | Menispermaceae | Stephania brachyandra | Ref. |
Plantae | Menispermaceae | Stephania cepharantha  | Ref. |
Plantae | Menispermaceae | Stephania dinklagei | Ref. |
Plantae | Menispermaceae | Stephania dinklaget | Ref. |
Plantae | Menispermaceae | Stephania lincangensis | Ref. |
Plantae | Menispermaceae | Stephania macrantha | Ref. |
Plantae | Menispermaceae | Stephania officinarum | Ref. |
Plantae | Menispermaceae | Stephania pierii | Ref. |
Plantae | Monimiaceae | Siparuna griseo-flavescens | Ref. |
Plantae | Papaveraceae | Glaucium corniculatum  | Ref. |
Plantae | Papaveraceae | Glaucium fimbrilligerum | Ref. |
Plantae | Papaveraceae | Glaucium flavum  | Ref. |
Plantae | Papaveraceae | Glaucium spp. | Ref. |
Plantae | Papaveraceae | Papaver commutatum | Ref. |
Plantae | Papaveraceae | Papaver confine | Ref. |
Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
Plantae | Papaveraceae | Papaver rhoeas  | Ref. |
Plantae | Papaveraceae | Papaver rhopalothece | Ref. |
Plantae | Papaveraceae | Papaver spp. | Ref. |
Plantae | Papaveraceae | Papaver stevenianum | Ref. |
Plantae | Ranunculaceae | Isopyrum thalictroides | Ref. |
Plantae | Ranunculaceae | Thalictrum delavayi | Ref. |
Plantae | Ranunculaceae | Thalictrum pedunculatum | Ref. |
Plantae | Ranunculaceae | Thalictrum urbainii | Ref. |
Plantae | Rutaceae | Xanthoxylum brachyacanthum | Ref. |
- | - | Dactylocapnos torulosa | Ref. |
|
|
zoom in
Organism | Thalictrum urbainii | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Hsieh, et al., Journal of Natural Products, 64, (2001), 1157.
Goren, et al., Planta Med, 69, (2003), 867 |
---|
|