Name |
dihydrokaempferol Dihydrokaempferol (+)-Dihydrokaempferol (+)-Aromadendrin Katuranin (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one (2R,3R)-Aromadendrin (+)-(2R,3R)-Dihydrokaempferol Aromadendrin |
Formula |
C15H12O6 |
Mw |
288.06338812 |
CAS RN |
480-20-6 |
C_ID |
C00007234
, 
|
InChIKey |
PADQINQHPQKXNL-PVRQQBJHNA-N |
InChICode |
InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@H]([C@H](C2=O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona muricata  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
Plantae | Asteraceae | Artemisia vestita  | Ref. |
Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica carinata Y line  | Ref. |
Plantae | Cruciferae | Raphanus sativus  | Ref. |
Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
Plantae | Cupressaceae | Juniperus lucayana | Ref. |
Plantae | Cupressaceae | Thuja orientalis  | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Fabaceae | Acacia catechu  | Ref. |
Plantae | Fabaceae | Afzelia bella | Ref. |
Plantae | Fabaceae | Cassia fistula  | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Sophora flavescens  | Ref. |
Plantae | Fabaceae | Sophora japonica  | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Lamiaceae | Coleus blumei  | Ref. |
Plantae | Lythraceae | Punica granatum L.  | Ref. |
Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
Plantae | Malvaceae | Tilia platyphyllos  | Ref. |
Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
Plantae | Moraceae | Maclura tinctoria  | Ref. |
Plantae | Moraceae | Morus alba  | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
Plantae | Myrtaceae | Eucalyptus macathurii | Ref. |
Plantae | Myrtaceae | Eucalyptus mackliana | Ref. |
Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus dombeyi  | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
Plantae | Pinaceae | Abies lasiocarpa | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
Plantae | Platanaceae | Platanus vulgaris | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
Plantae | Rhamnaceae | Hovenia dulcis  | Ref. |
Plantae | Rhamnaceae | Phyllogeiton zeyheri Sond. | Ref. |
Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rosaceae | Prunus amygdalus  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rosaceae | Prunus davidiana  | Ref. |
Plantae | Rosaceae | Prunus persica  | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Flindersia australis | Ref. |
Plantae | Rutaceae | Phellodendron amurense var.wilsonii  | Ref. |
Plantae | Salicaceae | Salix caprea  | Ref. |
Plantae | Solanaceae | Petunia hybrida | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis  | Ref. |
Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
- | - | Equsetum arvense | Ref. |
- | - | Nympaea spp. | Ref. |
|
|
zoom in
Organism | Salix caprea | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 671,Flavanones and dihydroflavonols
Hillis,Aust.J.Sci.Res.A.,5,(1952),379
King,J.Chem.Soc.,(1955),2948 |
---|
|