| Name |
Tectochrysin
5-hydroxy-7-methoxyflavone |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
520-28-5 |
| C_ID |
C00003795
, 
|
| InChIKey |
IRZVHDLBAYNPCT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccccc1)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Uvaria rufa | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Flourensia laurifolia | Ref. |
| Plantae | Asteraceae | Lychnophora markgravii | Ref. |
| Plantae | Bignoniaceae | Godmania aesculifolia | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Cistaceae | Cistus populifolius | Ref. |
| Plantae | Geraniaceae | Pelargonium crispum  | Ref. |
| Plantae | Labiatae | Collinsonia canadensis | Ref. |
| Plantae | Labiatae | Hoslundia opposita | Ref. |
| Plantae | Myricaceae | Comptonia peregrina | Ref. |
| Plantae | Pinaceae | Pinus spp. | Ref. |
| Plantae | Piperaceae | Piper manii | Ref. |
| Plantae | Piperaceae | Piper sylvaticum Roxb. | Ref. |
| Plantae | Rosaceae | Prunus avium | Ref. |
| Plantae | Rosaceae | Prunus cerasus | Ref. |
| Plantae | Rosaceae | Prunus spp. | Ref. |
| Plantae | Salicaceae | Populus davidiana | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora | Ref. |
|
|
zoom in
| Organism | Cistus populifolius |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids, (1967) Academic Press
Wollenweber,J.Plant Physiol.,117,(1985),423. |
|---|
|
