Name |
Juglanin Kaempferol 3-O-arabinoside (-)-Kaempferol 3-O-arabinoside |
Formula |
C20H18O10 |
Mw |
418.0899968 |
CAS RN |
5041-67-8 |
C_ID |
C00005132
,
|
InChIKey |
POQICXMTUPVZMX-CSYAPIQTNA-N |
InChICode |
InChI=1S/C20H18O10/c21-7-13-15(25)17(27)20(29-13)30-19-16(26)14-11(24)5-10(23)6-12(14)28-18(19)8-1-3-9(22)4-2-8/h1-6,13,15,17,20-25,27H,7H2/t13-,15-,17+,20-/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Guatteria rupestris | Ref. |
Plantae | Annonaceae | Guatteria villosissima | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aspleniaceae | Asplenium trichomanes-ramosum | Ref. |
Plantae | Euphorbiaceae | Speranskia tuberculata | Ref. |
Plantae | Juglandaceae | Juglans regia | Ref. |
Plantae | Malvaceae | Corchorus olitorius | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Rosaceae | Prunus spinosa | Ref. |
Plantae | Rosaceae | Rosa spp. | Ref. |
Plantae | Rosaceae | Sorbaria sorbifolia | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Saxifragaceae | Rodgersia podophylla | Ref. |
- | - | Tapirira guianensis | Ref. |
|
|
zoom in
Organism | Corchorus olitorius | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Gehmann,Naturwissenschaften,42,(1955),181 |
---|
|