| Name |
Isorhamnetin 3-O-neohesperidoside
Isorhamnetin 3-neohesperidoside
Isorhamnetin-3-O-neohesperidoside |
| Formula |
C28H32O16 |
| Mw |
624.16903498 |
| CAS RN |
55033-90-4 |
| C_ID |
C00005547
, 
|
| InChIKey |
QHLKSZBFIJJREC-GHLOOZCJNA-N |
| InChICode |
InChI=1S/C28H32O16/c1-9-18(33)21(36)23(38)27(40-9)44-26-22(37)19(34)16(8-29)42-28(26)43-25-20(35)17-13(32)6-11(30)7-15(17)41-24(25)10-3-4-12(31)14(5-10)39-2/h3-7,9,16,18-19,21-23,26-34,36-38H,8H2,1-2H3/t9-,16-,18-,19-,21+,22-,23-,26+,27-,28-/m0/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)CO)O)O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)c1ccc(c(c1)OC)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Cactaceae | Opuntia ficus-indica var.saboten | Ref. |
| Plantae | Cruciferae | Nerisyrenia gracilis | Ref. |
| Plantae | Cruciferae | Nerisyrenia linearifolia | Ref. |
| Plantae | Poaceae | Zea mays | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Typhaceae | Typha angustata | Ref. |
| Plantae | Typhaceae | Typha latifolia | Ref. |
| Plantae | Urticaceae | Parietaria officinalis | Ref. |
|
|
zoom in
| Organism | Typha angustata |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
YOSHIKAWA, et al., Chem Pharm Bull, 49, (2001), 863.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
