| Name |
Physcion
1,8-Dihydroxy-3-methyl-6-methoxyanthraquinone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
521-61-9 |
| C_ID |
C00019420
, 
|
| InChIKey |
FFWOKTFYGVYKIR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-7-3-9-13(11(17)4-7)16(20)14-10(15(9)19)5-8(21-2)6-12(14)18/h3-6,17-18H,1-2H3 |
| SMILES |
c1(cc(c2c(c1)C(=O)c1c(C2=O)c(cc(c1)C)O)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus terreus  | Ref. |
| Plantae | Asteraceae | Saussurea laniceps | Ref. |
| Plantae | Ephedraceae | Ephedra sinica | Ref. |
| Plantae | Fabaceae | Cassia acutifolia | Ref. |
| Plantae | Fabaceae | Cassia angustifolia | Ref. |
| Plantae | Fabaceae | Cassia nomae | Ref. |
| Plantae | Fabaceae | Cassia obtusifolia | Ref. |
| Plantae | Fabaceae | Cassia occidentalis | Ref. |
| Plantae | Fabaceae | Cassia tora | Ref. |
| Plantae | Fabaceae | Cassia torosa L. | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Senna sophera | Ref. |
| Plantae | Hypericaceae | Vismia laurentii | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Lardizabalaceae | Sargentodoxa cuneata | Ref. |
| Plantae | Picramniaceae | Alvaradoa jamaicensis | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum | Ref. |
| Plantae | Polygonaceae | Rheum emodi | Ref. |
| Plantae | Polygonaceae | Rheum maximowiczii | Ref. |
| Plantae | Polygonaceae | Rheum officinale | Ref. |
| Plantae | Polygonaceae | Rheum palmatum | Ref. |
| Plantae | Polygonaceae | Rheum tanguticum | Ref. |
| Plantae | Polygonaceae | Rumex acetosa | Ref. |
| Plantae | Polygonaceae | Rumex dentata | Ref. |
| Plantae | Polygonaceae | Rumex japonicus | Ref. |
| Plantae | Polygonaceae | Rumex nepalensis | Ref. |
| Plantae | Polygonaceae | Rumex patientia | Ref. |
| Plantae | Rhamnaceae | Berchemia floribunda | Ref. |
| Plantae | Rhamnaceae | Rhamnus nepalensis | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia L. | Ref. |
| Plantae | Rubiaceae | Morinda officinalis | Ref. |
|
|
zoom in
| Organism | Cassia obtusifolia |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Min, et al., CCMM, 23, (1998), 416.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Krenn, et al., JNP, 66, (2003), 1107.
Demirezer, et al., Phytochemistry, 58, (2001), 1213.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
