| Name |
Terpin-1-en-4-ol
Terpinen-4-ol
4-Terpineol
Terpin-4-ol
Terpineol-4
4-Methyl-1-(1-methylethyl)-3-cyclohexene-1-ol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
562-74-3 |
| C_ID |
C00029544
, 
|
| InChIKey |
WRYLYDPHFGVWKC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m1/s1 |
| SMILES |
C1C(=CC[C@@](C1)(C(C)C)O)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Pseudomonadaceae | Pseudomonas aeruginosa | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica | Ref. |
| Plantae | Annonaceae | Xylopia parviflora | Ref. |
| Plantae | Annonaceae | Xylopia sericea | Ref. |
| Plantae | Apiaceae | Daucus carota | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Apiaceae | Notopterygium forbesii | Ref. |
| Plantae | Apiaceae | Notopterygium incisum | Ref. |
| Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia anethoides | Ref. |
| Plantae | Asteraceae | Artemisia annua | Ref. |
| Plantae | Asteraceae | Artemisia argyi | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Centaurea orientalis | Ref. |
| Plantae | Asteraceae | Petasites albus | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Senecio vulgaris | Ref. |
| Plantae | Asteraceae | Tanacetum longifolium | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides | Ref. |
| Plantae | Fabaceae | Rhynchosia minima | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Labiatae | Lavandula angustifolia | Ref. |
| Plantae | Labiatae | Lavandula bipinnata | Ref. |
| Plantae | Labiatae | Lavandula dentata | Ref. |
| Plantae | Labiatae | Lavandula stoechas | Ref. |
| Plantae | Labiatae | Mentha arvensis L. | Ref. |
| Plantae | Labiatae | Mentha pulegium L. | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Labiatae | Tetradenia riparia | Ref. |
| Plantae | Labiatae | Thymus capitatus | Ref. |
| Plantae | Labiatae | Thymus piperella | Ref. |
| Plantae | Labiatae | Thymus vulgaris | Ref. |
| Plantae | Labiatae | Trichostema lanceolatum | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta | Ref. |
| Plantae | Lamiaceae | Coridothymus capitatus | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Laurus nobilis | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
| Plantae | Meliaceae | Azadirachta indica | Ref. |
| Plantae | Myrtaceae | Eucalyptus deglupta | Ref. |
| Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
| Plantae | Myrtaceae | Melaleuca alternifolia | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
| Plantae | Myrtaceae | Myrtus communis | Ref. |
| Plantae | Oleaceae | Forsythia suspensa | Ref. |
| Plantae | Pinaceae | Cedrus libani | Ref. |
| Plantae | Pinaceae | Pinus halepensis | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper arboreum | Ref. |
| Plantae | Piperaceae | Piper nigrum | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Rutaceae | Citrus paradisi | Ref. |
| Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis L. | Ref. |
| Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
| Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
| Plantae | Saururaceae | Houttuynia cordata | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis | Ref. |
| Plantae | Verbenaceae | Lippia javanica | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
| Plantae | Zingiberaceae | Curcuma longa | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
| Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb. | Ref. |
| Plantae | Zingiberaceae | Zingiber corallinum | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
| - | - | Alphinia galanga | Ref. |
| - | - | Baeckea frutescens L. | Ref. |
| - | - | Libanotis intermedia | Ref. |
| - | - | Melaneuca alternifolia | Ref. |
|
|
zoom in
| Organism | Daucus carota |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Calixto, et al., Planta Med, 70, (2004), 93.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
