Name |
Stigmasterol |
Formula |
C29H48O |
Mw |
412.37051615 |
CAS RN |
83-48-7 |
C_ID |
C00003674
, 
|
InChIKey |
HCXVJBMSMIARIN-WCWSWCBANA-N |
InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3/b9-8+/t20-,21+,23-,24-,25+,26-,27-,28-,29+/m0/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@H](/C=C/[C@H](C(C)C)CC)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
Chromalveolata | Pelagophyceae | Aureoumbra lagunensis | Ref. |
Fungi | Elaphomycetaceae | Monascus pilosus BCRC38072 | Ref. |
Fungi | Meripilaceae | Antrodia camphorata | Ref. |
Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS  | Ref. |
Plantae | Acanthaceae | Ruellia tuberosa  | Ref. |
Plantae | Adoxaceae | Sambucus canadensis  | Ref. |
Plantae | Adoxaceae | Sambucus nigra. | Ref. |
Plantae | Amaranthaceae | Blutaparon portulacoides | Ref. |
Plantae | Amaranthaceae | Gomphrena celosioides | Ref. |
Plantae | Annonaceae | Annona purpurea  | Ref. |
Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
Plantae | Annonaceae | Goniothalamus amuyon | Ref. |
Plantae | Annonaceae | Polyalthia longifolia var.pendula  | Ref. |
Plantae | Annonaceae | Xylopia aromatica  | Ref. |
Plantae | Annonaceae | Xylopia brasiliensis | Ref. |
Plantae | Annonaceae | Xylopia emarginata | Ref. |
Plantae | Apiaceae | Angelica sinensis  | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Apiaceae | Ferula diversivittata | Ref. |
Plantae | Apiaceae | Ferula szowitsiana | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Apiaceae | Glehnia littoralis  | Ref. |
Plantae | Apiaceae | Heracleum wallichii | Ref. |
Plantae | Apocynaceae | Alstonia scholaris  | Ref. |
Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
Plantae | Araliaceae | Cussonia bancoensis | Ref. |
Plantae | Araliaceae | Eleutherococcus senticosus Rupr.and Maxim.  | Ref. |
Plantae | Araliaceae | Panax ginseng  | Ref. |
Plantae | Araliaceae | Panax pseudo-ginseng var.notoginseng  | Ref. |
Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
Plantae | Asphodelaceae | Asphodelus albus  | Ref. |
Plantae | Asteraceae | Achillea millefolium  | Ref. |
Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
Plantae | Asteraceae | Artemisia annua L.  | Ref. |
Plantae | Asteraceae | Artemisia argyi  | Ref. |
Plantae | Asteraceae | Artemisia sieversiana  | Ref. |
Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
Plantae | Asteraceae | Calendula officinalis L.  | Ref. |
Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
Plantae | Asteraceae | Centipeda minima  | Ref. |
Plantae | Asteraceae | Cichorium intybus  | Ref. |
Plantae | Asteraceae | Cirsium japonicum  | Ref. |
Plantae | Asteraceae | Conyza aegyptica | Ref. |
Plantae | Asteraceae | Elephantopus scaber  | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee.  | Ref. |
Plantae | Asteraceae | Gonospermum gomerae | Ref. |
Plantae | Asteraceae | Gynura segetum | Ref. |
Plantae | Asteraceae | Hertia cheirifolia | Ref. |
Plantae | Asteraceae | Heterothalamus spartioides | Ref. |
Plantae | Asteraceae | Inula anatolica | Ref. |
Plantae | Asteraceae | Inula cappa  | Ref. |
Plantae | Asteraceae | Lactuca indica  | Ref. |
Plantae | Asteraceae | Launaea arborescens | Ref. |
Plantae | Asteraceae | Pluchea indica Less.  | Ref. |
Plantae | Asteraceae | Pulicaria canariensis | Ref. |
Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
Plantae | Asteraceae | Saussurea lappa  | Ref. |
Plantae | Asteraceae | Saussurea muliensis | Ref. |
Plantae | Asteraceae | Senecio viravira | Ref. |
Plantae | Asteraceae | Stevia porphyrea | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Asteraceae | Taraxacum officinale  | Ref. |
Plantae | Asteraceae | Xanthium sibiricum  | Ref. |
Plantae | Asteraceae | Xanthium strumarium  | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Betulaceae | Corylus avellana  | Ref. |
Plantae | Betulaceae | Corylus maxima  | Ref. |
Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
Plantae | Buddlejaceae | Buddleja madagascariensis | Ref. |
Plantae | Calycanthaceae | Calycanthus floridus | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula var.modesta  | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen  | Ref. |
Plantae | Canellaceae | Cinnamosma madagascariensis | Ref. |
Plantae | Caprifoliaceae/Diervillaceae/Dipsacaceae/Linnaeaceae/Valerianaceae | Lonicera japonica  | Ref. |
Plantae | Chrysobalanaceae | Couepia polyandra | Ref. |
Plantae | Clusiaceae | Pentaphalangium solomonse Warb. | Ref. |
Plantae | Clusiaceae-Guttiferae | Allanblackia floribunda  | Ref. |
Plantae | Clusiaceae-Guttiferae | Tovomita brasiliensis | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia afzelii ENGL.  | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ  | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora  | Ref. |
Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
Plantae | Combretaceae | Terminalia superba  | Ref. |
Plantae | Convallariaceae | Ophiopogon japonicus  | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Raphanus sativus  | Ref. |
Plantae | Cucurbitaceae | Herpetospermum caudigerum WALL | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Dioscoreaceae | Dioscorea batatas  | Ref. |
Plantae | Dioscoreaceae | Dioscorea cyphocarpa | Ref. |
Plantae | Dioscoreaceae | Tamus communis L.  | Ref. |
Plantae | Ebenaceae | Diospyros buxifolia  | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros diepenhorstii  | Ref. |
Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros kaki  | Ref. |
Plantae | Ebenaceae | Diospyros mollis  | Ref. |
Plantae | Ebenaceae | Diospyros montana  | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
Plantae | Ebenaceae | Diospyros variegata | Ref. |
Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
Plantae | Euphorbiaceae | Aleurites fordii Hemsl. | Ref. |
Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr.  | Ref. |
Plantae | Euphorbiaceae | Croton urucurana Baill. | Ref. |
Plantae | Euphorbiaceae | Croton zambesicus  | Ref. |
Plantae | Euphorbiaceae | Euphorbia indica  | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
Plantae | Euphorbiaceae | Euphorbia sessiliflora Roxb. | Ref. |
Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
Plantae | Euphorbiaceae | Trigonostemon reidioides | Ref. |
Plantae | Fabaceae | Abrus precatorius  | Ref. |
Plantae | Fabaceae | Arachis hypogaea  | Ref. |
Plantae | Fabaceae | Astragalus glycyphyllos  | Ref. |
Plantae | Fabaceae | Bauhinia candicans | Ref. |
Plantae | Fabaceae | Bauhinia vahlii L.  | Ref. |
Plantae | Fabaceae | Butea monosperma  | Ref. |
Plantae | Fabaceae | Caesalpinia decapetala  | Ref. |
Plantae | Fabaceae | Caesalpinia minax | Ref. |
Plantae | Fabaceae | Caragana microphylla  | Ref. |
Plantae | Fabaceae | Centrosema pubescens | Ref. |
Plantae | Fabaceae | Cicer arietinum  | Ref. |
Plantae | Fabaceae | Dolichos lablab  | Ref. |
Plantae | Fabaceae | Erythrina arborescens Roxb. | Ref. |
Plantae | Fabaceae | Erythrina indica  | Ref. |
Plantae | Fabaceae | Eysenhardtia polystachya | Ref. |
Plantae | Fabaceae | Gleditsia sinensis LAM.  | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Medicago sativa  | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Fabaceae | Physostigma venenosum  | Ref. |
Plantae | Fabaceae | Prosopis spicigera  | Ref. |
Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
Plantae | Fabaceae | Pterodon apraricioi | Ref. |
Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
Plantae | Fumariaceae | Corydalis remota | Ref. |
Plantae | Gentianaceae | Gentiana lutea L.  | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hydrocharitaceae | Halophila ovalis | Ref. |
Plantae | Hydrocharitaceae | Halophila ovata | Ref. |
Plantae | Hydrocharitaceae | Halophila spinulosa | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Hypericaceae | Hypericum beanii | Ref. |
Plantae | Hypericaceae | Hypericum carinatum | Ref. |
Plantae | Hypericaceae | Vismia laurentii  | Ref. |
Plantae | Iridaceae | Iris soforana | Ref. |
Plantae | Jubulaceae | Frullania brasiliensis | Ref. |
Plantae | Jubulaceae | Frullania monocera | Ref. |
Plantae | Labiatae | Ajuga taiwanensis | Ref. |
Plantae | Labiatae | Anisomeles indica  | Ref. |
Plantae | Labiatae | Callicarpa pilosissima | Ref. |
Plantae | Labiatae | Leonurus persicus | Ref. |
Plantae | Labiatae | Leucas cephalotes SPRENG.  | Ref. |
Plantae | Labiatae | Ocimum spicatum | Ref. |
Plantae | Labiatae | Perilla frutescens var.acuta  | Ref. |
Plantae | Labiatae | Perilla frutescens var.crispa  | Ref. |
Plantae | Labiatae | Salvia aegyptiaca  | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Labiatae | Sideritis kuegleriana | Ref. |
Plantae | Labiatae | Sideritis lotsyi | Ref. |
Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
Plantae | Labiatae | Sideritis soluta | Ref. |
Plantae | Labiatae | Sideritis tenoi | Ref. |
Plantae | Lardizabalaceae | Akebia quinata  | Ref. |
Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
Plantae | Lauraceae | Lindera obtusiloba | Ref. |
Plantae | Lauraceae | Neolitsea acuminatissima | Ref. |
Plantae | Lecythidaceae | Barringtonia racemosa  | Ref. |
Plantae | Liliaceae | Lilium brownii var.viridulum | Ref. |
Plantae | Longaniaceae | Strychnos dolychothyrsa | Ref. |
Plantae | Longaniaceae | Strychnos potatorum  | Ref. |
Plantae | Loranthaceae | Loranthus falcatus  | Ref. |
Plantae | Lycopodiaceae | Lycopodium cernuum  | Ref. |
Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum  | Ref. |
Plantae | Lythraceae | Punica granatum  | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Meliaceae | Aphanamixis polystachya  | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Meliaceae | Guarea rhophalocarpa | Ref. |
Plantae | Meliaceae | Khaya ivorensis  | Ref. |
Plantae | Meliaceae | Khaya senegalensis L.  | Ref. |
Plantae | Meliaceae | Toona sinensis  | Ref. |
Plantae | Menispermaceae | Sinomenium acutum  | Ref. |
Plantae | Moraceae | Brosimum acutifolium  | Ref. |
Plantae | Moraceae | Ficus hirta  | Ref. |
Plantae | Moraceae | Ficus septica | Ref. |
Plantae | Myristicaceae | Virola surinamensis  | Ref. |
Plantae | Myrsinaceae | Embelia schimperi  | Ref. |
Plantae | Myrtaceae | Feijoa sellowiana  | Ref. |
Plantae | Ochnaceae | Ouratea sulcata | Ref. |
Plantae | Orchidaceae | Arundina chinensis | Ref. |
Plantae | Palmae | Cocos nucifera  | Ref. |
Plantae | Papaveraceae | Papaver somniferum  | Ref. |
Plantae | Piperaceae | Piper kadsura  | Ref. |
Plantae | Piperaceae | Piper methysticum Forst.f.  | Ref. |
Plantae | Piperaceae | Piper nigrum L.  | Ref. |
Plantae | Piperaceae | Piper philippinum | Ref. |
Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
Plantae | Plantaginaceae | Plantago major  | Ref. |
Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
Plantae | Poaceae | Arundo donax  | Ref. |
Plantae | Poaceae | Coix lacryma-jobi  | Ref. |
Plantae | Poaceae | Hordeum vulgare L.cv Mammut  | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Poaceae | Saccharum sinensis | Ref. |
Plantae | Poaceae | Zea mays L.  | Ref. |
Plantae | Polygalaceae | Polygala arillata | Ref. |
Plantae | Polygalaceae | Polygala caudata | Ref. |
Plantae | Polypodiaceae | Drynaria fortunei  | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
Plantae | Putranjivaceae | Drypetes inaequalis | Ref. |
Plantae | Ranunculaceae | Pulsatilla cernua  | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
Plantae | Rosaceae | Spiraea formosana  | Ref. |
Plantae | Rubiaceae | Adina pilulifera | Ref. |
Plantae | Rubiaceae | Hedyotis corymbosa  | Ref. |
Plantae | Rubiaceae | Morinda umbellata | Ref. |
Plantae | Rubiaceae | Mussaenda pubescens  | Ref. |
Plantae | Rubiaceae | Oldenlandia diffusa  | Ref. |
Plantae | Rubiaceae | Paederia foetida  | Ref. |
Plantae | Rubiaceae | Psychotria serpens  | Ref. |
Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
Plantae | Ruppiaceae | Ruppia maritima | Ref. |
Plantae | Rutaceae | Atalantia buxifolia | Ref. |
Plantae | Rutaceae | Citrus tankan | Ref. |
Plantae | Rutaceae | Fagara heitzii | Ref. |
Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
Plantae | Rutaceae | Luvunga sarmentosa (Bl.) Kurz. | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Rutaceae | Oriciopsis glaberrima ENGL. | Ref. |
Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
Plantae | Santalaceae | Santalum album  | Ref. |
Plantae | Santalaceae | Scleropyrum wallichianum  | Ref. |
Plantae | Santalaceae | Viscum coloratum  | Ref. |
Plantae | Sapindaceae | Dodonaea viscosa  | Ref. |
Plantae | Sapindaceae | Schleichera trijuga  | Ref. |
Plantae | Sapotaceae | Sebertia acuminata | Ref. |
Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
Plantae | Schistochilaceae | Schistochila glaucescens | Ref. |
Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
Plantae | Solanaceae | Lycium chinense  | Ref. |
Plantae | Solanaceae | Nicandra physaloides | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
Plantae | Solanaceae | Solanum chacoense Bitt. | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Solanaceae | Withania somnifera  | Ref. |
Plantae | Stemonaceae | Stemona collinsae | Ref. |
Plantae | Taxaceae | Taxus cuspidata  | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
Plantae | Ulmaceae | Celtis laevigata | Ref. |
Plantae | Ulmaceae | Ulmus pervifolia | Ref. |
Plantae | Ulmaceae | Ulmus pumila  | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
Plantae | Verbenaceae | Clerodendron cyrtophyllum | Ref. |
Plantae | Verbenaceae | Clerodendron neutens | Ref. |
Plantae | Verbenaceae | Clerodendron serratum  | Ref. |
- | - | Asteracantha longifolia  | Ref. |
- | - | Changium smyrnioides | Ref. |
- | - | Chorisia insignis | Ref. |
- | - | Chorisia speciosa | Ref. |
- | - | Cyanara scolymus | Ref. |
- | - | Dictanopteris pedata | Ref. |
- | - | Dicteostelium discoideum | Ref. |
- | - | Dynamena pumila | Ref. |
- | - | Euphoria longan | Ref. |
- | - | Gleditsea sinensis | Ref. |
- | - | Lanurocerasus officinalis | Ref. |
- | - | Laurencia obtusa  | Ref. |
- | - | Libanotis intermedia | Ref. |
- | - | Moghania strobilifera  | Ref. |
- | - | Siegesbeckia orientalis  | Ref. |
|
|
zoom in
Organism | Xanthium sibiricum | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Mao, et al., APS, 31, (1996), 118.
Gu, et al., APS, 32, (1997), 59.
Feng, et al., CCMM, 19, (1994), 611.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
Wu, et al., JNP, 64, (2001), 71.
Lin, et al., JNP, 64, (2001), 674.
Wu, et al., JNP, 64, (2001), 1040.
Jiang, et al., JNP, 64, (2001), 1266.
Block, et al., Phytochemistry, 65, (2004), 1165.
WU, et al., Chem Pharm Bull, 51, (2003), 948.
LIM, et al., Chem Pharm Bull, 53, (2005), 561.
CHAN, et al., Chem Pharm Bull, 53, (2005), 836.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
SUKSAMRARN, et al., Chem Pharm Bull, 53, (2005), 1327.
Liou, et al., JNP, 65, (2002), 1283.
Pan, et al., JNP, 66, (2003), 161.
Lan, et al., JNP, 66, (2003), 487.
Wu, et al., JNP, 66, (2003), 996.
Camacho, et al., Phytochemistry, 56, (2001), 203.
Chaturvedula, et al., Planta Med, 69, (2003), 271.
Lin, et al., Planta Med, 69, (2003), 757.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|