| Name |
Palmitoleic acid
(Z)-Palmitoleic acid
cis-Palmitoleic acid |
| Formula |
C16H30O2 |
| Mw |
254.2245802 |
| CAS RN |
373-49-9 |
| C_ID |
C00001234
, 
|
| InChIKey |
SECPZKHBENQXJG-FPLPWBNLSA-N |
| InChICode |
InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7- |
| SMILES |
CCCCCC/C=C\CCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asphodelaceae | Aloe vera var.chinensis | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta | Ref. |
| Plantae | Cruciferae | Isatis tinctoria | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
| Plantae | Labiatae | Vitex trifolia | Ref. |
| Plantae | Laminariaceae | Laminaria japonica | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
| Plantae | Palmae | Elaeis guineensis | Ref. |
| Plantae | Proteaceae | Macadamia ternifolia | Ref. |
| Plantae | Rosaceae | Prunus armeniaca | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla | Ref. |
| - | - | Calopyllum calaba | Ref. |
|
|
zoom in
| Organism | Trichosanthes kirilowii |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Morikawa, et al., JNP, 65, (2002), 1468 |
|---|
|
