Name |
Procyanidin B4 Catechin-(4alpha->8)-epicatechin |
Formula |
C30H26O12 |
Mw |
578.1424263 |
CAS RN |
29106-51-2 |
C_ID |
C00002935
,
|
InChIKey |
XFZJEEAOWLFHDH-MDUHQJCGNA-N |
InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27-,28-,29+/m0/s1 |
SMILES |
[C@H]1([C@@H](Oc2c(C1)c(cc(c2[C@@H]1[C@@H]([C@H](Oc2c1c(cc(c2)O)O)c1ccc(c(c1)O)O)O)O)O)c1ccc(c(c1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Adoxaceae | Viburnum burkwoodii | Ref. |
Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
Plantae | Ericaceae | Vaccinium myritillus | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
Plantae | Rosaceae | Cowania mexicana | Ref. |
Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
Plantae | Rosaceae | Malus spp. | Ref. |
Plantae | Rosaceae | Rubus fruticosus | Ref. |
Plantae | Rosaceae | Rubus idaeus | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
Organism | Theobroma cacao | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Thompson,J.Chem.Soc.Perkin Trans.,1,(1972),1387 |
---|
|