Name |
alpha-Terpinene |
Formula |
C10H16 |
Mw |
136.12520051 |
CAS RN |
99-86-5 |
C_ID |
C00003060
, 
|
InChIKey |
YHQGMYUVUMAZJR-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
SMILES |
C1CC(=CC=C1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Monodora myristica  | Ref. |
Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
Plantae | Apiaceae | Cicuta virosa  | Ref. |
Plantae | Apiaceae | Coriandrum sativum  | Ref. |
Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua  | Ref. |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
Plantae | Asteraceae | Conyza newii  | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Fabaceae | Trifolium repens L.  | Ref. |
Plantae | Fagaceae | Quercus coccifera  | Ref. |
Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
Plantae | Labiatae | Mentha arvensis L.  | Ref. |
Plantae | Labiatae | Mentha piperita L.  | Ref. |
Plantae | Labiatae | Mosla dianthera  | Ref. |
Plantae | Labiatae | Ocimum americanum  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Labiatae | Ocimum gratissimum  | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum spp. | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
Plantae | Labiatae | Origanum majorana  | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Satureja subspicata  | Ref. |
Plantae | Labiatae | Tetradenia riparia  | Ref. |
Plantae | Labiatae | Thymus capitatus  | Ref. |
Plantae | Labiatae | Thymus vulgaris  | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Cinnamomum parthenoxylum | Ref. |
Plantae | Lauraceae | Litsea ceylanica | Ref. |
Plantae | Meliaceae | Azadirachta indica  | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis x urophylla  | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
Plantae | Myrtaceae | Myrtus communis  | Ref. |
Plantae | Pinaceae | Cedrus libani  | Ref. |
Plantae | Pinaceae | Pinus halepensis  | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper arboreum  | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum  | Ref. |
Plantae | Plagiochilaceae | Plagiochila standleyi | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
Plantae | Rutaceae | Citrus grandis  | Ref. |
Plantae | Rutaceae | Citrus hystrix  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Saururaceae | Houttuynia cordata  | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Verbenaceae | Lippia javanica  | Ref. |
Plantae | Verbenaceae | Lippia multiflora  | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
Plantae | Zingiberaceae | Elettaria cardamomum  | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L.  | Ref. |
- | - | Canabis sativa | Ref. |
- | - | Citrus | Ref. |
- | - | Eucalyptus | Ref. |
|
|
zoom in
Organism | Foeniculum vulgare | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Calixto, et al., Planta Med, 69, (2003), 973 |
---|
|